beta-Pompilidotoxin
Modify Date: 2025-09-08 07:40:36
beta-Pompilidotoxin structure
|
Common Name | beta-Pompilidotoxin | ||
|---|---|---|---|---|
| CAS Number | 216064-36-7 | Molecular Weight | 1557.88000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C71H124N22O17 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | N/A | |
Use of beta-Pompilidotoxinβ-Pompilidotoxin (β-PMTX), a wasp venom, can slow sodium channel inactivation and increases steady-state sodium current in cells[1]. |
| Name | β-Pompilidotoxin |
|---|---|
| Synonym | More Synonyms |
| Description | β-Pompilidotoxin (β-PMTX), a wasp venom, can slow sodium channel inactivation and increases steady-state sodium current in cells[1]. |
|---|---|
| Related Catalog | |
| In Vitro | β-Pompilidotoxin (β-PMTX) increases resurgent current in wild-type neurons and induced resurgent current in med neurons. β-Pompilidotoxin (10 μM) modestly but significantly increased the decay time constant (τdecay) of currents evoked by a step from -90 to 0 mV from 0.52 to 0.73 msec in wild-type Purkinje cells[1]. |
| References |
| Molecular Formula | C71H124N22O17 |
|---|---|
| Molecular Weight | 1557.88000 |
| Exact Mass | 1556.95000 |
| PSA | 668.75000 |
| LogP | 4.98310 |
| InChIKey | YBOJYGJMKPMNRC-UHFFFAOYSA-N |
| SMILES | CCC(C)C(NC(=O)C(N)CCCN=C(N)N)C(=O)NC(CCCCN)C(=O)NC(C(=O)NCC(=O)NC(CC(C)C)C(=O)NC(Cc1ccccc1)C(=O)NC(CC(=O)O)C(=O)NC(CCC(N)=O)C(=O)NC(CC(C)C)C(=O)NC(CO)C(=O)NC(CCCN=C(N)N)C(=O)NC(CC(C)C)C(N)=O)C(C)CC |
| WGK Germany | 3 |
|---|
| RIKIGLFDQLSRL-NH2 |
| Beta-Pompilidotoxin |
| b-Pompilidotoxin |