Ortho-fluorobutyryl fentanyl
Modify Date: 2026-07-04 19:35:04
Ortho-fluorobutyryl fentanyl structure
|
Common Name | Ortho-fluorobutyryl fentanyl | ||
|---|---|---|---|---|
| CAS Number | 2163847-76-3 | Molecular Weight | 368.5 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C23H29FN2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Ortho-fluorobutyryl fentanyl |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C23H29FN2O |
|---|---|
| Molecular Weight | 368.5 |
| InChIKey | NLSYMTDGNNFMCX-UHFFFAOYSA-N |
| SMILES | CCCC(=O)N(c1ccccc1F)C1CCN(CCc2ccccc2)CC1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 2163847-76-3? |
| A: Chinese name of 2163847-76-3 is 2163847-76-3. |
| Q: What is the molecular weight of Ortho-fluorobutyryl fentanyl? |
| A: Molecular weight of Ortho-fluorobutyryl fentanyl is 368.5. |
| Q: What is the molecular formula of Ortho-fluorobutyryl fentanyl? |
| A: Molecular formula of Ortho-fluorobutyryl fentanyl is C23H29FN2O. |
| Q: What is the CAS number of Ortho-fluorobutyryl fentanyl? |
| A: CAS number of Ortho-fluorobutyryl fentanyl is 2163847-76-3. |
| Q: What is the InChIKey of Ortho-fluorobutyryl fentanyl? |
| A: InChIKey of Ortho-fluorobutyryl fentanyl is NLSYMTDGNNFMCX-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of Ortho-fluorobutyryl fentanyl? |
| A: SMILES notation of Ortho-fluorobutyryl fentanyl is CCCC(=O)N(c1ccccc1F)C1CCN(CCc2ccccc2)CC1. |
| Q: What is the English name of Ortho-fluorobutyryl fentanyl? |
| A: The English name of Ortho-fluorobutyryl fentanyl is Ortho-fluorobutyryl fentanyl. |