2,6-Dichloro-4-fluoro-N-hydroxybenzimidoyl Chloride
Modify Date: 2026-09-27 00:12:04
2,6-Dichloro-4-fluoro-N-hydroxybenzimidoyl Chloride structure
|
Common Name | 2,6-Dichloro-4-fluoro-N-hydroxybenzimidoyl Chloride | ||
|---|---|---|---|---|
| CAS Number | 2165357-42-4 | Molecular Weight | 242.5 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C7H3Cl3FNO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2,6-Dichloro-4-fluoro-N-hydroxybenzimidoyl Chloride |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C7H3Cl3FNO |
|---|---|
| Molecular Weight | 242.5 |
| InChIKey | NPLISPOULZRKEC-UHFFFAOYSA-N |
| SMILES | ON=C(Cl)c1c(Cl)cc(F)cc1Cl |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 2165357-42-4? |
| A: Chinese name of 2165357-42-4 is 2165357-42-4. |
| Q: What is the InChIKey of 2,6-Dichloro-4-fluoro-N-hydroxybenzimidoyl Chloride? |
| A: InChIKey of 2,6-Dichloro-4-fluoro-N-hydroxybenzimidoyl Chloride is NPLISPOULZRKEC-UHFFFAOYSA-N. |
| Q: What is the English name of 2,6-Dichloro-4-fluoro-N-hydroxybenzimidoyl Chloride? |
| A: The English name of 2,6-Dichloro-4-fluoro-N-hydroxybenzimidoyl Chloride is 2,6-Dichloro-4-fluoro-N-hydroxybenzimidoyl Chloride. |
| Q: What is the molecular formula of 2,6-Dichloro-4-fluoro-N-hydroxybenzimidoyl Chloride? |
| A: Molecular formula of 2,6-Dichloro-4-fluoro-N-hydroxybenzimidoyl Chloride is C7H3Cl3FNO. |
| Q: What is the SMILES notation of 2,6-Dichloro-4-fluoro-N-hydroxybenzimidoyl Chloride? |
| A: SMILES notation of 2,6-Dichloro-4-fluoro-N-hydroxybenzimidoyl Chloride is ON=C(Cl)c1c(Cl)cc(F)cc1Cl. |
| Q: What is the molecular weight of 2,6-Dichloro-4-fluoro-N-hydroxybenzimidoyl Chloride? |
| A: Molecular weight of 2,6-Dichloro-4-fluoro-N-hydroxybenzimidoyl Chloride is 242.5. |
| Q: What is the CAS number of 2,6-Dichloro-4-fluoro-N-hydroxybenzimidoyl Chloride? |
| A: CAS number of 2,6-Dichloro-4-fluoro-N-hydroxybenzimidoyl Chloride is 2165357-42-4. |