p-(Bis(2-bromoethyl)amino)phenol o-methylbenzoate structure
|
Common Name | p-(Bis(2-bromoethyl)amino)phenol o-methylbenzoate | ||
|---|---|---|---|---|
| CAS Number | 21667-02-7 | Molecular Weight | 441.15700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H19Br2NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-Methylbenzoesaeure-4-(N,N-bis-(2-bromethyl)-amino)-phenylester |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C18H19Br2NO2 |
|---|---|
| Molecular Weight | 441.15700 |
| Exact Mass | 438.97800 |
| PSA | 29.54000 |
| LogP | 4.81040 |
| InChIKey | YYLJRENQBJIZGV-UHFFFAOYSA-N |
| SMILES | Cc1ccccc1C(=O)Oc1ccc(N(CCBr)CCBr)cc1 |
| HS Code | 2922199090 |
|---|
| HS Code | 2922199090 |
|---|---|
| Summary | 2922199090. other amino-alcohols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2-Methylbenzoesaeure-4-[N,N-bis-(2-bromethyl)-amino]-phenylester |
| PARA-(BIS(2-BROMOETHYL)AMINO)PHENOL-ORTHO-METHYLBENZOATE |