2,6,10-Trioxa-14-azadispiro[4.1.6^{7}.3^{5}]hexadecane
Modify Date: 2025-10-23 21:10:10
![2,6,10-Trioxa-14-azadispiro[4.1.6^{7}.3^{5}]hexadecane Structure](https://www.chemsrc.com/extcaspic/158/2166710-81-0.png)
2,6,10-Trioxa-14-azadispiro[4.1.6^{7}.3^{5}]hexadecane structure
|
Common Name | 2,6,10-Trioxa-14-azadispiro[4.1.6^{7}.3^{5}]hexadecane | ||
|---|---|---|---|---|
| CAS Number | 2166710-81-0 | Molecular Weight | 227.30 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H21NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2,6,10-Trioxa-14-azadispiro[4.1.6^{7}.3^{5}]hexadecane |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H21NO3 |
|---|---|
| Molecular Weight | 227.30 |
| InChIKey | PERYEYZFNNRCSJ-UHFFFAOYSA-N |
| SMILES | C1COCCC2(C1)NCCC1(CCOC1)O2 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 2,6,10-Trioxa-14-azadispiro[4.1.6^{7}.3^{5}]hexadecane? |
| A: InChIKey of 2,6,10-Trioxa-14-azadispiro[4.1.6^{7}.3^{5}]hexadecane is PERYEYZFNNRCSJ-UHFFFAOYSA-N. |
| Q: What is the CAS number of 2,6,10-Trioxa-14-azadispiro[4.1.6^{7}.3^{5}]hexadecane? |
| A: CAS number of 2,6,10-Trioxa-14-azadispiro[4.1.6^{7}.3^{5}]hexadecane is 2166710-81-0. |
| Q: What is the Chinese name of 2166710-81-0? |
| A: Chinese name of 2166710-81-0 is 2166710-81-0. |
| Q: What is the molecular formula of 2,6,10-Trioxa-14-azadispiro[4.1.6^{7}.3^{5}]hexadecane? |
| A: Molecular formula of 2,6,10-Trioxa-14-azadispiro[4.1.6^{7}.3^{5}]hexadecane is C12H21NO3. |
| Q: What is the SMILES notation of 2,6,10-Trioxa-14-azadispiro[4.1.6^{7}.3^{5}]hexadecane? |
| A: SMILES notation of 2,6,10-Trioxa-14-azadispiro[4.1.6^{7}.3^{5}]hexadecane is C1COCCC2(C1)NCCC1(CCOC1)O2. |
| Q: What is the English name of 2,6,10-Trioxa-14-azadispiro[4.1.6^{7}.3^{5}]hexadecane? |
| A: The English name of 2,6,10-Trioxa-14-azadispiro[4.1.6^{7}.3^{5}]hexadecane is 2,6,10-Trioxa-14-azadispiro[4.1.6^{7}.3^{5}]hexadecane. |
| Q: What is the molecular weight of 2,6,10-Trioxa-14-azadispiro[4.1.6^{7}.3^{5}]hexadecane? |
| A: Molecular weight of 2,6,10-Trioxa-14-azadispiro[4.1.6^{7}.3^{5}]hexadecane is 227.30. |