4-(Propan-2-yl)-5-oxa-10-azadispiro[2.2.3^{6}.2^{3}]undecane
Modify Date: 2025-09-05 02:53:52
![4-(Propan-2-yl)-5-oxa-10-azadispiro[2.2.3^{6}.2^{3}]undecane Structure](https://www.chemsrc.com/extcaspic/343/2166883-61-8.png)
4-(Propan-2-yl)-5-oxa-10-azadispiro[2.2.3^{6}.2^{3}]undecane structure
|
Common Name | 4-(Propan-2-yl)-5-oxa-10-azadispiro[2.2.3^{6}.2^{3}]undecane | ||
|---|---|---|---|---|
| CAS Number | 2166883-61-8 | Molecular Weight | 195.30 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H21NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-(Propan-2-yl)-5-oxa-10-azadispiro[2.2.3^{6}.2^{3}]undecane |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H21NO |
|---|---|
| Molecular Weight | 195.30 |
| InChIKey | OKFONCQHZWLSPM-UHFFFAOYSA-N |
| SMILES | CC(C)C1OC2(CCC2)NCC12CC2 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 4-(Propan-2-yl)-5-oxa-10-azadispiro[2.2.3^{6}.2^{3}]undecane? |
| A: Molecular formula of 4-(Propan-2-yl)-5-oxa-10-azadispiro[2.2.3^{6}.2^{3}]undecane is C12H21NO. |
| Q: What is the CAS number of 4-(Propan-2-yl)-5-oxa-10-azadispiro[2.2.3^{6}.2^{3}]undecane? |
| A: CAS number of 4-(Propan-2-yl)-5-oxa-10-azadispiro[2.2.3^{6}.2^{3}]undecane is 2166883-61-8. |
| Q: What is the English name of 4-(Propan-2-yl)-5-oxa-10-azadispiro[2.2.3^{6}.2^{3}]undecane? |
| A: The English name of 4-(Propan-2-yl)-5-oxa-10-azadispiro[2.2.3^{6}.2^{3}]undecane is 4-(Propan-2-yl)-5-oxa-10-azadispiro[2.2.3^{6}.2^{3}]undecane. |
| Q: What is the InChIKey of 4-(Propan-2-yl)-5-oxa-10-azadispiro[2.2.3^{6}.2^{3}]undecane? |
| A: InChIKey of 4-(Propan-2-yl)-5-oxa-10-azadispiro[2.2.3^{6}.2^{3}]undecane is OKFONCQHZWLSPM-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 4-(Propan-2-yl)-5-oxa-10-azadispiro[2.2.3^{6}.2^{3}]undecane? |
| A: Molecular weight of 4-(Propan-2-yl)-5-oxa-10-azadispiro[2.2.3^{6}.2^{3}]undecane is 195.30. |
| Q: What is the Chinese name of 2166883-61-8? |
| A: Chinese name of 2166883-61-8 is 2166883-61-8. |
| Q: What is the SMILES notation of 4-(Propan-2-yl)-5-oxa-10-azadispiro[2.2.3^{6}.2^{3}]undecane? |
| A: SMILES notation of 4-(Propan-2-yl)-5-oxa-10-azadispiro[2.2.3^{6}.2^{3}]undecane is CC(C)C1OC2(CCC2)NCC12CC2. |