Carbonicacid, bis(4-chlorophenyl) ester structure
|
Common Name | Carbonicacid, bis(4-chlorophenyl) ester | ||
|---|---|---|---|---|
| CAS Number | 2167-53-5 | Molecular Weight | 283.10700 | |
| Density | 1.395g/cm3 | Boiling Point | 368.1ºC at 760mmHg | |
| Molecular Formula | C13H8Cl2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 149.3ºC | |
| Name | bis(4-chlorophenyl) carbonate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.395g/cm3 |
|---|---|
| Boiling Point | 368.1ºC at 760mmHg |
| Molecular Formula | C13H8Cl2O3 |
| Molecular Weight | 283.10700 |
| Flash Point | 149.3ºC |
| Exact Mass | 281.98500 |
| PSA | 35.53000 |
| LogP | 4.57120 |
| Vapour Pressure | 1.3E-05mmHg at 25°C |
| Index of Refraction | 1.595 |
| InChIKey | FSTRGOSTJXVFGV-UHFFFAOYSA-N |
| SMILES | O=C(Oc1ccc(Cl)cc1)Oc1ccc(Cl)cc1 |
| HS Code | 2920909090 |
|---|
| Precursor 10 | |
|---|---|
| DownStream 2 | |
| HS Code | 2920909090 |
|---|---|
| Summary | 2920909090 esters of other inorganic acids of non-metals (excluding esters of hydrogen halides) and their salts; their halogenated, sulphonated, nitrated or nitrosated derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| carbonic acid bis-(4-chloro-phenyl ester) |
| Bis-(4-chlor-phenyl)-carbonat |
| Kohlensaeure-bis-(4-chlor-phenylester) |
| 4,4'-dichlorodiphenyl carbonate |
| bis-p-chlorophenyl carbonate |
| di(p-chlorophenyl)carbonate |