2-[Amino(cyclopropyl)methyl]-4-bromo-3,6-dichlorophenol
Modify Date: 2025-11-07 00:23:03
![2-[Amino(cyclopropyl)methyl]-4-bromo-3,6-dichlorophenol Structure](https://www.chemsrc.com/extcaspic/021/2167282-95-1.png)
2-[Amino(cyclopropyl)methyl]-4-bromo-3,6-dichlorophenol structure
|
Common Name | 2-[Amino(cyclopropyl)methyl]-4-bromo-3,6-dichlorophenol | ||
|---|---|---|---|---|
| CAS Number | 2167282-95-1 | Molecular Weight | 311.00 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H10BrCl2NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-[Amino(cyclopropyl)methyl]-4-bromo-3,6-dichlorophenol |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H10BrCl2NO |
|---|---|
| Molecular Weight | 311.00 |
| InChIKey | VTPXYPJMRQNJSO-UHFFFAOYSA-N |
| SMILES | NC(c1c(O)c(Cl)cc(Br)c1Cl)C1CC1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 2-[Amino(cyclopropyl)methyl]-4-bromo-3,6-dichlorophenol? |
| A: Molecular formula of 2-[Amino(cyclopropyl)methyl]-4-bromo-3,6-dichlorophenol is C10H10BrCl2NO. |
| Q: What is the CAS number of 2-[Amino(cyclopropyl)methyl]-4-bromo-3,6-dichlorophenol? |
| A: CAS number of 2-[Amino(cyclopropyl)methyl]-4-bromo-3,6-dichlorophenol is 2167282-95-1. |
| Q: What is the SMILES notation of 2-[Amino(cyclopropyl)methyl]-4-bromo-3,6-dichlorophenol? |
| A: SMILES notation of 2-[Amino(cyclopropyl)methyl]-4-bromo-3,6-dichlorophenol is NC(c1c(O)c(Cl)cc(Br)c1Cl)C1CC1. |
| Q: What is the Chinese name of 2167282-95-1? |
| A: Chinese name of 2167282-95-1 is 2167282-95-1. |
| Q: What is the English name of 2-[Amino(cyclopropyl)methyl]-4-bromo-3,6-dichlorophenol? |
| A: The English name of 2-[Amino(cyclopropyl)methyl]-4-bromo-3,6-dichlorophenol is 2-[Amino(cyclopropyl)methyl]-4-bromo-3,6-dichlorophenol. |
| Q: What is the InChIKey of 2-[Amino(cyclopropyl)methyl]-4-bromo-3,6-dichlorophenol? |
| A: InChIKey of 2-[Amino(cyclopropyl)methyl]-4-bromo-3,6-dichlorophenol is VTPXYPJMRQNJSO-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 2-[Amino(cyclopropyl)methyl]-4-bromo-3,6-dichlorophenol? |
| A: Molecular weight of 2-[Amino(cyclopropyl)methyl]-4-bromo-3,6-dichlorophenol is 311.00. |