Methyl 2-(1-bromo-2-methoxyethyl)-1,3-thiazole-4-carboxylate
Modify Date: 2025-11-07 19:45:05
Methyl 2-(1-bromo-2-methoxyethyl)-1,3-thiazole-4-carboxylate structure
|
Common Name | Methyl 2-(1-bromo-2-methoxyethyl)-1,3-thiazole-4-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 2167512-65-2 | Molecular Weight | 280.14 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H10BrNO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Methyl 2-(1-bromo-2-methoxyethyl)-1,3-thiazole-4-carboxylate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C8H10BrNO3S |
|---|---|
| Molecular Weight | 280.14 |
| InChIKey | SDYIQHPWVJWIGH-UHFFFAOYSA-N |
| SMILES | COCC(Br)c1nc(C(=O)OC)cs1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of Methyl 2-(1-bromo-2-methoxyethyl)-1,3-thiazole-4-carboxylate? |
| A: Molecular weight of Methyl 2-(1-bromo-2-methoxyethyl)-1,3-thiazole-4-carboxylate is 280.14. |
| Q: What is the molecular formula of Methyl 2-(1-bromo-2-methoxyethyl)-1,3-thiazole-4-carboxylate? |
| A: Molecular formula of Methyl 2-(1-bromo-2-methoxyethyl)-1,3-thiazole-4-carboxylate is C8H10BrNO3S. |
| Q: What is the InChIKey of Methyl 2-(1-bromo-2-methoxyethyl)-1,3-thiazole-4-carboxylate? |
| A: InChIKey of Methyl 2-(1-bromo-2-methoxyethyl)-1,3-thiazole-4-carboxylate is SDYIQHPWVJWIGH-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of Methyl 2-(1-bromo-2-methoxyethyl)-1,3-thiazole-4-carboxylate? |
| A: SMILES notation of Methyl 2-(1-bromo-2-methoxyethyl)-1,3-thiazole-4-carboxylate is COCC(Br)c1nc(C(=O)OC)cs1. |
| Q: What is the English name of Methyl 2-(1-bromo-2-methoxyethyl)-1,3-thiazole-4-carboxylate? |
| A: The English name of Methyl 2-(1-bromo-2-methoxyethyl)-1,3-thiazole-4-carboxylate is Methyl 2-(1-bromo-2-methoxyethyl)-1,3-thiazole-4-carboxylate. |
| Q: What is the Chinese name of 2167512-65-2? |
| A: Chinese name of 2167512-65-2 is 2167512-65-2. |
| Q: What is the CAS number of Methyl 2-(1-bromo-2-methoxyethyl)-1,3-thiazole-4-carboxylate? |
| A: CAS number of Methyl 2-(1-bromo-2-methoxyethyl)-1,3-thiazole-4-carboxylate is 2167512-65-2. |