9,9-Difluoro-5-oxa-12-azadispiro[2.2.5^{6}.2^{3}]tridecane
Modify Date: 2025-09-17 16:02:01
![9,9-Difluoro-5-oxa-12-azadispiro[2.2.5^{6}.2^{3}]tridecane Structure](https://www.chemsrc.com/extcaspic/132/2167780-82-5.png)
9,9-Difluoro-5-oxa-12-azadispiro[2.2.5^{6}.2^{3}]tridecane structure
|
Common Name | 9,9-Difluoro-5-oxa-12-azadispiro[2.2.5^{6}.2^{3}]tridecane | ||
|---|---|---|---|---|
| CAS Number | 2167780-82-5 | Molecular Weight | 217.26 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H17F2NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 9,9-Difluoro-5-oxa-12-azadispiro[2.2.5^{6}.2^{3}]tridecane |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H17F2NO |
|---|---|
| Molecular Weight | 217.26 |
| InChIKey | QQWFFPSOOIKDSN-UHFFFAOYSA-N |
| SMILES | FC1(F)CCC2(CC1)NCC1(CC1)CO2 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 9,9-Difluoro-5-oxa-12-azadispiro[2.2.5^{6}.2^{3}]tridecane? |
| A: CAS number of 9,9-Difluoro-5-oxa-12-azadispiro[2.2.5^{6}.2^{3}]tridecane is 2167780-82-5. |
| Q: What is the English name of 9,9-Difluoro-5-oxa-12-azadispiro[2.2.5^{6}.2^{3}]tridecane? |
| A: The English name of 9,9-Difluoro-5-oxa-12-azadispiro[2.2.5^{6}.2^{3}]tridecane is 9,9-Difluoro-5-oxa-12-azadispiro[2.2.5^{6}.2^{3}]tridecane. |
| Q: What is the SMILES notation of 9,9-Difluoro-5-oxa-12-azadispiro[2.2.5^{6}.2^{3}]tridecane? |
| A: SMILES notation of 9,9-Difluoro-5-oxa-12-azadispiro[2.2.5^{6}.2^{3}]tridecane is FC1(F)CCC2(CC1)NCC1(CC1)CO2. |
| Q: What is the Chinese name of 2167780-82-5? |
| A: Chinese name of 2167780-82-5 is 2167780-82-5. |
| Q: What is the InChIKey of 9,9-Difluoro-5-oxa-12-azadispiro[2.2.5^{6}.2^{3}]tridecane? |
| A: InChIKey of 9,9-Difluoro-5-oxa-12-azadispiro[2.2.5^{6}.2^{3}]tridecane is QQWFFPSOOIKDSN-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 9,9-Difluoro-5-oxa-12-azadispiro[2.2.5^{6}.2^{3}]tridecane? |
| A: Molecular formula of 9,9-Difluoro-5-oxa-12-azadispiro[2.2.5^{6}.2^{3}]tridecane is C11H17F2NO. |
| Q: What is the molecular weight of 9,9-Difluoro-5-oxa-12-azadispiro[2.2.5^{6}.2^{3}]tridecane? |
| A: Molecular weight of 9,9-Difluoro-5-oxa-12-azadispiro[2.2.5^{6}.2^{3}]tridecane is 217.26. |