5-{8-Azabicyclo[3.2.1]octan-3-yl}-1,3,2lambda6-dioxathiane-2,2-dione
Modify Date: 2026-07-10 10:43:43
![5-{8-Azabicyclo[3.2.1]octan-3-yl}-1,3,2lambda6-dioxathiane-2,2-dione Structure](https://www.chemsrc.com/extcaspic/184/2167948-09-4.png)
5-{8-Azabicyclo[3.2.1]octan-3-yl}-1,3,2lambda6-dioxathiane-2,2-dione structure
|
Common Name | 5-{8-Azabicyclo[3.2.1]octan-3-yl}-1,3,2lambda6-dioxathiane-2,2-dione | ||
|---|---|---|---|---|
| CAS Number | 2167948-09-4 | Molecular Weight | 247.31 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H17NO4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 5-{8-Azabicyclo[3.2.1]octan-3-yl}-1,3,2lambda6-dioxathiane-2,2-dione |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H17NO4S |
|---|---|
| Molecular Weight | 247.31 |
| InChIKey | RXZQNRXURYHUBC-UHFFFAOYSA-N |
| SMILES | O=S1(=O)OCC(C2CC3CCC(C2)N3)CO1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 5-{8-Azabicyclo[3.2.1]octan-3-yl}-1,3,2lambda6-dioxathiane-2,2-dione? |
| A: CAS number of 5-{8-Azabicyclo[3.2.1]octan-3-yl}-1,3,2lambda6-dioxathiane-2,2-dione is 2167948-09-4. |
| Q: What is the molecular formula of 5-{8-Azabicyclo[3.2.1]octan-3-yl}-1,3,2lambda6-dioxathiane-2,2-dione? |
| A: Molecular formula of 5-{8-Azabicyclo[3.2.1]octan-3-yl}-1,3,2lambda6-dioxathiane-2,2-dione is C10H17NO4S. |
| Q: What is the English name of 5-{8-Azabicyclo[3.2.1]octan-3-yl}-1,3,2lambda6-dioxathiane-2,2-dione? |
| A: The English name of 5-{8-Azabicyclo[3.2.1]octan-3-yl}-1,3,2lambda6-dioxathiane-2,2-dione is 5-{8-Azabicyclo[3.2.1]octan-3-yl}-1,3,2lambda6-dioxathiane-2,2-dione. |
| Q: What is the InChIKey of 5-{8-Azabicyclo[3.2.1]octan-3-yl}-1,3,2lambda6-dioxathiane-2,2-dione? |
| A: InChIKey of 5-{8-Azabicyclo[3.2.1]octan-3-yl}-1,3,2lambda6-dioxathiane-2,2-dione is RXZQNRXURYHUBC-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 5-{8-Azabicyclo[3.2.1]octan-3-yl}-1,3,2lambda6-dioxathiane-2,2-dione? |
| A: Molecular weight of 5-{8-Azabicyclo[3.2.1]octan-3-yl}-1,3,2lambda6-dioxathiane-2,2-dione is 247.31. |
| Q: What is the SMILES notation of 5-{8-Azabicyclo[3.2.1]octan-3-yl}-1,3,2lambda6-dioxathiane-2,2-dione? |
| A: SMILES notation of 5-{8-Azabicyclo[3.2.1]octan-3-yl}-1,3,2lambda6-dioxathiane-2,2-dione is O=S1(=O)OCC(C2CC3CCC(C2)N3)CO1. |
| Q: What is the Chinese name of 2167948-09-4? |
| A: Chinese name of 2167948-09-4 is 2167948-09-4. |