8-Methyl-1-(3-methylbutan-2-yl)-1,7-diazaspiro[4.5]decane
Modify Date: 2025-08-29 08:51:41
![8-Methyl-1-(3-methylbutan-2-yl)-1,7-diazaspiro[4.5]decane Structure](https://www.chemsrc.com/extcaspic/091/2167978-44-9.png)
8-Methyl-1-(3-methylbutan-2-yl)-1,7-diazaspiro[4.5]decane structure
|
Common Name | 8-Methyl-1-(3-methylbutan-2-yl)-1,7-diazaspiro[4.5]decane | ||
|---|---|---|---|---|
| CAS Number | 2167978-44-9 | Molecular Weight | 224.39 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H28N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 8-Methyl-1-(3-methylbutan-2-yl)-1,7-diazaspiro[4.5]decane |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H28N2 |
|---|---|
| Molecular Weight | 224.39 |
| InChIKey | KVPVSJYEQRWNOB-UHFFFAOYSA-N |
| SMILES | CC1CCC2(CCCN2C(C)C(C)C)CN1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 2167978-44-9? |
| A: Chinese name of 2167978-44-9 is 2167978-44-9. |
| Q: What is the molecular formula of 8-Methyl-1-(3-methylbutan-2-yl)-1,7-diazaspiro[4.5]decane? |
| A: Molecular formula of 8-Methyl-1-(3-methylbutan-2-yl)-1,7-diazaspiro[4.5]decane is C14H28N2. |
| Q: What is the SMILES notation of 8-Methyl-1-(3-methylbutan-2-yl)-1,7-diazaspiro[4.5]decane? |
| A: SMILES notation of 8-Methyl-1-(3-methylbutan-2-yl)-1,7-diazaspiro[4.5]decane is CC1CCC2(CCCN2C(C)C(C)C)CN1. |
| Q: What is the English name of 8-Methyl-1-(3-methylbutan-2-yl)-1,7-diazaspiro[4.5]decane? |
| A: The English name of 8-Methyl-1-(3-methylbutan-2-yl)-1,7-diazaspiro[4.5]decane is 8-Methyl-1-(3-methylbutan-2-yl)-1,7-diazaspiro[4.5]decane. |
| Q: What is the molecular weight of 8-Methyl-1-(3-methylbutan-2-yl)-1,7-diazaspiro[4.5]decane? |
| A: Molecular weight of 8-Methyl-1-(3-methylbutan-2-yl)-1,7-diazaspiro[4.5]decane is 224.39. |
| Q: What is the CAS number of 8-Methyl-1-(3-methylbutan-2-yl)-1,7-diazaspiro[4.5]decane? |
| A: CAS number of 8-Methyl-1-(3-methylbutan-2-yl)-1,7-diazaspiro[4.5]decane is 2167978-44-9. |
| Q: What is the InChIKey of 8-Methyl-1-(3-methylbutan-2-yl)-1,7-diazaspiro[4.5]decane? |
| A: InChIKey of 8-Methyl-1-(3-methylbutan-2-yl)-1,7-diazaspiro[4.5]decane is KVPVSJYEQRWNOB-UHFFFAOYSA-N. |