[5-(oxan-4-yl)-1-(propan-2-yl)-1H-1,2,3-triazol-4-yl]methanol
Modify Date: 2026-07-12 13:29:21
![[5-(oxan-4-yl)-1-(propan-2-yl)-1H-1,2,3-triazol-4-yl]methanol Structure](https://www.chemsrc.com/extcaspic/347/2167980-54-1.png)
[5-(oxan-4-yl)-1-(propan-2-yl)-1H-1,2,3-triazol-4-yl]methanol structure
|
Common Name | [5-(oxan-4-yl)-1-(propan-2-yl)-1H-1,2,3-triazol-4-yl]methanol | ||
|---|---|---|---|---|
| CAS Number | 2167980-54-1 | Molecular Weight | 225.29 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H19N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | [5-(oxan-4-yl)-1-(propan-2-yl)-1H-1,2,3-triazol-4-yl]methanol |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H19N3O2 |
|---|---|
| Molecular Weight | 225.29 |
| InChIKey | ZDLKBSKMWJRZIZ-UHFFFAOYSA-N |
| SMILES | CC(C)n1nnc(CO)c1C1CCOCC1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of [5-(oxan-4-yl)-1-(propan-2-yl)-1H-1,2,3-triazol-4-yl]methanol? |
| A: Molecular formula of [5-(oxan-4-yl)-1-(propan-2-yl)-1H-1,2,3-triazol-4-yl]methanol is C11H19N3O2. |
| Q: What is the Chinese name of 2167980-54-1? |
| A: Chinese name of 2167980-54-1 is 2167980-54-1. |
| Q: What is the InChIKey of [5-(oxan-4-yl)-1-(propan-2-yl)-1H-1,2,3-triazol-4-yl]methanol? |
| A: InChIKey of [5-(oxan-4-yl)-1-(propan-2-yl)-1H-1,2,3-triazol-4-yl]methanol is ZDLKBSKMWJRZIZ-UHFFFAOYSA-N. |
| Q: What is the molecular weight of [5-(oxan-4-yl)-1-(propan-2-yl)-1H-1,2,3-triazol-4-yl]methanol? |
| A: Molecular weight of [5-(oxan-4-yl)-1-(propan-2-yl)-1H-1,2,3-triazol-4-yl]methanol is 225.29. |
| Q: What is the CAS number of [5-(oxan-4-yl)-1-(propan-2-yl)-1H-1,2,3-triazol-4-yl]methanol? |
| A: CAS number of [5-(oxan-4-yl)-1-(propan-2-yl)-1H-1,2,3-triazol-4-yl]methanol is 2167980-54-1. |
| Q: What is the English name of [5-(oxan-4-yl)-1-(propan-2-yl)-1H-1,2,3-triazol-4-yl]methanol? |
| A: The English name of [5-(oxan-4-yl)-1-(propan-2-yl)-1H-1,2,3-triazol-4-yl]methanol is [5-(oxan-4-yl)-1-(propan-2-yl)-1H-1,2,3-triazol-4-yl]methanol. |
| Q: What is the SMILES notation of [5-(oxan-4-yl)-1-(propan-2-yl)-1H-1,2,3-triazol-4-yl]methanol? |
| A: SMILES notation of [5-(oxan-4-yl)-1-(propan-2-yl)-1H-1,2,3-triazol-4-yl]methanol is CC(C)n1nnc(CO)c1C1CCOCC1. |