10,10-Dimethyl-9-oxa-11-azadispiro[3.0.3^{5}.4^{4}]dodecane
Modify Date: 2026-07-01 17:39:25
![10,10-Dimethyl-9-oxa-11-azadispiro[3.0.3^{5}.4^{4}]dodecane Structure](https://www.chemsrc.com/extcaspic/420/2168191-81-7.png)
10,10-Dimethyl-9-oxa-11-azadispiro[3.0.3^{5}.4^{4}]dodecane structure
|
Common Name | 10,10-Dimethyl-9-oxa-11-azadispiro[3.0.3^{5}.4^{4}]dodecane | ||
|---|---|---|---|---|
| CAS Number | 2168191-81-7 | Molecular Weight | 195.30 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H21NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 10,10-Dimethyl-9-oxa-11-azadispiro[3.0.3^{5}.4^{4}]dodecane |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H21NO |
|---|---|
| Molecular Weight | 195.30 |
| InChIKey | SDPYRGQOOQHSQU-UHFFFAOYSA-N |
| SMILES | CC1(C)NCC2(CCC2)C2(CCC2)O1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 10,10-Dimethyl-9-oxa-11-azadispiro[3.0.3^{5}.4^{4}]dodecane? |
| A: The English name of 10,10-Dimethyl-9-oxa-11-azadispiro[3.0.3^{5}.4^{4}]dodecane is 10,10-Dimethyl-9-oxa-11-azadispiro[3.0.3^{5}.4^{4}]dodecane. |
| Q: What is the CAS number of 10,10-Dimethyl-9-oxa-11-azadispiro[3.0.3^{5}.4^{4}]dodecane? |
| A: CAS number of 10,10-Dimethyl-9-oxa-11-azadispiro[3.0.3^{5}.4^{4}]dodecane is 2168191-81-7. |
| Q: What is the molecular formula of 10,10-Dimethyl-9-oxa-11-azadispiro[3.0.3^{5}.4^{4}]dodecane? |
| A: Molecular formula of 10,10-Dimethyl-9-oxa-11-azadispiro[3.0.3^{5}.4^{4}]dodecane is C12H21NO. |
| Q: What is the Chinese name of 2168191-81-7? |
| A: Chinese name of 2168191-81-7 is 2168191-81-7. |
| Q: What is the SMILES notation of 10,10-Dimethyl-9-oxa-11-azadispiro[3.0.3^{5}.4^{4}]dodecane? |
| A: SMILES notation of 10,10-Dimethyl-9-oxa-11-azadispiro[3.0.3^{5}.4^{4}]dodecane is CC1(C)NCC2(CCC2)C2(CCC2)O1. |
| Q: What is the molecular weight of 10,10-Dimethyl-9-oxa-11-azadispiro[3.0.3^{5}.4^{4}]dodecane? |
| A: Molecular weight of 10,10-Dimethyl-9-oxa-11-azadispiro[3.0.3^{5}.4^{4}]dodecane is 195.30. |
| Q: What is the InChIKey of 10,10-Dimethyl-9-oxa-11-azadispiro[3.0.3^{5}.4^{4}]dodecane? |
| A: InChIKey of 10,10-Dimethyl-9-oxa-11-azadispiro[3.0.3^{5}.4^{4}]dodecane is SDPYRGQOOQHSQU-UHFFFAOYSA-N. |