2-phenyl-5-pyridin-2-yl-4H-pyrazol-3-one structure
|
Common Name | 2-phenyl-5-pyridin-2-yl-4H-pyrazol-3-one | ||
|---|---|---|---|---|
| CAS Number | 21683-60-3 | Molecular Weight | 237.25700 | |
| Density | 1.24g/cm3 | Boiling Point | 391.9ºC at 760 mmHg | |
| Molecular Formula | C14H11N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 190.8ºC | |
| Name | 2-phenyl-5-pyridin-2-yl-4H-pyrazol-3-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.24g/cm3 |
|---|---|
| Boiling Point | 391.9ºC at 760 mmHg |
| Molecular Formula | C14H11N3O |
| Molecular Weight | 237.25700 |
| Flash Point | 190.8ºC |
| Exact Mass | 237.09000 |
| PSA | 45.56000 |
| LogP | 1.72320 |
| Vapour Pressure | 2.38E-06mmHg at 25°C |
| Index of Refraction | 1.662 |
| InChIKey | DNRWJXHJUQHCAD-UHFFFAOYSA-N |
| SMILES | O=C1CC(c2ccccn2)=NN1c1ccccc1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-phenyl-5-pyridin-2-yl-1,2-dihydro-pyrazol-3-one |
| 1-Phenyl-3-(2'-pyridyl)-5-pyrazolone |
| 2-Phenyl-5-(2-pyridinyl)-2,4-dihydro-3H-pyrazol-3-one |