9,13-Dimethyl-5-oxa-12-azadispiro[2.2.5^{6}.2^{3}]tridecane
Modify Date: 2025-09-10 17:22:27
![9,13-Dimethyl-5-oxa-12-azadispiro[2.2.5^{6}.2^{3}]tridecane Structure](https://www.chemsrc.com/extcaspic/183/2168361-46-2.png)
9,13-Dimethyl-5-oxa-12-azadispiro[2.2.5^{6}.2^{3}]tridecane structure
|
Common Name | 9,13-Dimethyl-5-oxa-12-azadispiro[2.2.5^{6}.2^{3}]tridecane | ||
|---|---|---|---|---|
| CAS Number | 2168361-46-2 | Molecular Weight | 209.33 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H23NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 9,13-Dimethyl-5-oxa-12-azadispiro[2.2.5^{6}.2^{3}]tridecane |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H23NO |
|---|---|
| Molecular Weight | 209.33 |
| InChIKey | BBFMZQMXCQJVNT-UHFFFAOYSA-N |
| SMILES | CC1CCC2(CC1)NC(C)C1(CC1)CO2 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 9,13-Dimethyl-5-oxa-12-azadispiro[2.2.5^{6}.2^{3}]tridecane? |
| A: The English name of 9,13-Dimethyl-5-oxa-12-azadispiro[2.2.5^{6}.2^{3}]tridecane is 9,13-Dimethyl-5-oxa-12-azadispiro[2.2.5^{6}.2^{3}]tridecane. |
| Q: What is the CAS number of 9,13-Dimethyl-5-oxa-12-azadispiro[2.2.5^{6}.2^{3}]tridecane? |
| A: CAS number of 9,13-Dimethyl-5-oxa-12-azadispiro[2.2.5^{6}.2^{3}]tridecane is 2168361-46-2. |
| Q: What is the Chinese name of 2168361-46-2? |
| A: Chinese name of 2168361-46-2 is 2168361-46-2. |
| Q: What is the molecular weight of 9,13-Dimethyl-5-oxa-12-azadispiro[2.2.5^{6}.2^{3}]tridecane? |
| A: Molecular weight of 9,13-Dimethyl-5-oxa-12-azadispiro[2.2.5^{6}.2^{3}]tridecane is 209.33. |
| Q: What is the InChIKey of 9,13-Dimethyl-5-oxa-12-azadispiro[2.2.5^{6}.2^{3}]tridecane? |
| A: InChIKey of 9,13-Dimethyl-5-oxa-12-azadispiro[2.2.5^{6}.2^{3}]tridecane is BBFMZQMXCQJVNT-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 9,13-Dimethyl-5-oxa-12-azadispiro[2.2.5^{6}.2^{3}]tridecane? |
| A: Molecular formula of 9,13-Dimethyl-5-oxa-12-azadispiro[2.2.5^{6}.2^{3}]tridecane is C13H23NO. |
| Q: What is the SMILES notation of 9,13-Dimethyl-5-oxa-12-azadispiro[2.2.5^{6}.2^{3}]tridecane? |
| A: SMILES notation of 9,13-Dimethyl-5-oxa-12-azadispiro[2.2.5^{6}.2^{3}]tridecane is CC1CCC2(CC1)NC(C)C1(CC1)CO2. |