[5-(difluoromethyl)-1-ethyl-1H-1,2,3-triazol-4-yl]methanesulfonyl chloride
Modify Date: 2025-08-31 21:47:04
![[5-(difluoromethyl)-1-ethyl-1H-1,2,3-triazol-4-yl]methanesulfonyl chloride Structure](https://www.chemsrc.com/extcaspic/445/2169192-63-4.png)
[5-(difluoromethyl)-1-ethyl-1H-1,2,3-triazol-4-yl]methanesulfonyl chloride structure
|
Common Name | [5-(difluoromethyl)-1-ethyl-1H-1,2,3-triazol-4-yl]methanesulfonyl chloride | ||
|---|---|---|---|---|
| CAS Number | 2169192-63-4 | Molecular Weight | 259.66 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C6H8ClF2N3O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | [5-(difluoromethyl)-1-ethyl-1H-1,2,3-triazol-4-yl]methanesulfonyl chloride |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C6H8ClF2N3O2S |
|---|---|
| Molecular Weight | 259.66 |
| InChIKey | RATAJZNUHLJLNU-UHFFFAOYSA-N |
| SMILES | CCn1nnc(CS(=O)(=O)Cl)c1C(F)F |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of [5-(difluoromethyl)-1-ethyl-1H-1,2,3-triazol-4-yl]methanesulfonyl chloride? |
| A: Molecular weight of [5-(difluoromethyl)-1-ethyl-1H-1,2,3-triazol-4-yl]methanesulfonyl chloride is 259.66. |
| Q: What is the CAS number of [5-(difluoromethyl)-1-ethyl-1H-1,2,3-triazol-4-yl]methanesulfonyl chloride? |
| A: CAS number of [5-(difluoromethyl)-1-ethyl-1H-1,2,3-triazol-4-yl]methanesulfonyl chloride is 2169192-63-4. |
| Q: What is the molecular formula of [5-(difluoromethyl)-1-ethyl-1H-1,2,3-triazol-4-yl]methanesulfonyl chloride? |
| A: Molecular formula of [5-(difluoromethyl)-1-ethyl-1H-1,2,3-triazol-4-yl]methanesulfonyl chloride is C6H8ClF2N3O2S. |
| Q: What is the InChIKey of [5-(difluoromethyl)-1-ethyl-1H-1,2,3-triazol-4-yl]methanesulfonyl chloride? |
| A: InChIKey of [5-(difluoromethyl)-1-ethyl-1H-1,2,3-triazol-4-yl]methanesulfonyl chloride is RATAJZNUHLJLNU-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of [5-(difluoromethyl)-1-ethyl-1H-1,2,3-triazol-4-yl]methanesulfonyl chloride? |
| A: SMILES notation of [5-(difluoromethyl)-1-ethyl-1H-1,2,3-triazol-4-yl]methanesulfonyl chloride is CCn1nnc(CS(=O)(=O)Cl)c1C(F)F. |
| Q: What is the English name of [5-(difluoromethyl)-1-ethyl-1H-1,2,3-triazol-4-yl]methanesulfonyl chloride? |
| A: The English name of [5-(difluoromethyl)-1-ethyl-1H-1,2,3-triazol-4-yl]methanesulfonyl chloride is [5-(difluoromethyl)-1-ethyl-1H-1,2,3-triazol-4-yl]methanesulfonyl chloride. |
| Q: What is the Chinese name of 2169192-63-4? |
| A: Chinese name of 2169192-63-4 is 2169192-63-4. |