2-[3-(2,2,2-Trifluoroethoxy)phenoxy]ethanol
Modify Date: 2025-09-09 17:30:53
![2-[3-(2,2,2-Trifluoroethoxy)phenoxy]ethanol Structure](https://www.chemsrc.com/extcaspic/490/2169570-32-3.png)
2-[3-(2,2,2-Trifluoroethoxy)phenoxy]ethanol structure
|
Common Name | 2-[3-(2,2,2-Trifluoroethoxy)phenoxy]ethanol | ||
|---|---|---|---|---|
| CAS Number | 2169570-32-3 | Molecular Weight | 236.19 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H11F3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-[3-(2,2,2-Trifluoroethoxy)phenoxy]ethanol |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H11F3O3 |
|---|---|
| Molecular Weight | 236.19 |
| InChIKey | ISVJRKSWBRZLQC-UHFFFAOYSA-N |
| SMILES | OCCOc1cccc(OCC(F)(F)F)c1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 2169570-32-3? |
| A: Chinese name of 2169570-32-3 is 2169570-32-3. |
| Q: What is the molecular weight of 2-[3-(2,2,2-Trifluoroethoxy)phenoxy]ethanol? |
| A: Molecular weight of 2-[3-(2,2,2-Trifluoroethoxy)phenoxy]ethanol is 236.19. |
| Q: What is the English name of 2-[3-(2,2,2-Trifluoroethoxy)phenoxy]ethanol? |
| A: The English name of 2-[3-(2,2,2-Trifluoroethoxy)phenoxy]ethanol is 2-[3-(2,2,2-Trifluoroethoxy)phenoxy]ethanol. |
| Q: What is the CAS number of 2-[3-(2,2,2-Trifluoroethoxy)phenoxy]ethanol? |
| A: CAS number of 2-[3-(2,2,2-Trifluoroethoxy)phenoxy]ethanol is 2169570-32-3. |
| Q: What is the SMILES notation of 2-[3-(2,2,2-Trifluoroethoxy)phenoxy]ethanol? |
| A: SMILES notation of 2-[3-(2,2,2-Trifluoroethoxy)phenoxy]ethanol is OCCOc1cccc(OCC(F)(F)F)c1. |
| Q: What is the molecular formula of 2-[3-(2,2,2-Trifluoroethoxy)phenoxy]ethanol? |
| A: Molecular formula of 2-[3-(2,2,2-Trifluoroethoxy)phenoxy]ethanol is C10H11F3O3. |
| Q: What is the InChIKey of 2-[3-(2,2,2-Trifluoroethoxy)phenoxy]ethanol? |
| A: InChIKey of 2-[3-(2,2,2-Trifluoroethoxy)phenoxy]ethanol is ISVJRKSWBRZLQC-UHFFFAOYSA-N. |