3-Indolyl-β-D-glucuronide cyclohexanamine structure
|
Common Name | 3-Indolyl-β-D-glucuronide cyclohexanamine | ||
|---|---|---|---|---|
| CAS Number | 216971-58-3 | Molecular Weight | 408.44600 | |
| Density | N/A | Boiling Point | 669ºC at 760 mmHg | |
| Molecular Formula | C20H28N2O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 358.4ºC | |
Use of 3-Indolyl-β-D-glucuronide cyclohexanamine3-Indolyl-β-D-glucuronide cyclohexanamine is the glucose component of X-Gluc staining buffer. 3-Indolyl-β-D-glucuronide cyclohexanamine can be used to detect gene expression. The active ingredient of the stain, β-Glucuronidase (GUS), reacts with the enzyme, causing the target gene to appear blue-purple in tissues or cells, so that the expression level and tissue distribution of the gene can be visually observed[1]. |
| Name | 3-Indolyl--D-glucuronideCyclohexylammoniumsalt |
|---|
| Description | 3-Indolyl-β-D-glucuronide cyclohexanamine is the glucose component of X-Gluc staining buffer. 3-Indolyl-β-D-glucuronide cyclohexanamine can be used to detect gene expression. The active ingredient of the stain, β-Glucuronidase (GUS), reacts with the enzyme, causing the target gene to appear blue-purple in tissues or cells, so that the expression level and tissue distribution of the gene can be visually observed[1]. |
|---|---|
| Related Catalog | |
| References |
| Boiling Point | 669ºC at 760 mmHg |
|---|---|
| Molecular Formula | C20H28N2O7 |
| Molecular Weight | 408.44600 |
| Flash Point | 358.4ºC |
| Exact Mass | 408.19000 |
| PSA | 158.26000 |
| LogP | 1.41700 |
| Vapour Pressure | 8.25E-19mmHg at 25°C |
| InChIKey | YGIPNZMTCTUCAX-CYRSAHDMSA-N |
| SMILES | NC1CCCCC1.O=C(O)C1OC(Oc2c[nH]c3ccccc23)C(O)C(O)C1O |