3-dimethylamino-1-[4-(3-dimethylaminopropanoyl)phenyl]propan-1-one structure
|
Common Name | 3-dimethylamino-1-[4-(3-dimethylaminopropanoyl)phenyl]propan-1-one | ||
|---|---|---|---|---|
| CAS Number | 21702-05-6 | Molecular Weight | 312.83500 | |
| Density | 1.038g/cm3 | Boiling Point | 407.5ºC at 760 mmHg | |
| Molecular Formula | C16H25ClN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 165.6ºC | |
| Name | 3-(dimethylamino)-1-[4-[3-(dimethylamino)propanoyl]phenyl]propan-1-one,hydrochloride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.038g/cm3 |
|---|---|
| Boiling Point | 407.5ºC at 760 mmHg |
| Molecular Formula | C16H25ClN2O2 |
| Molecular Weight | 312.83500 |
| Flash Point | 165.6ºC |
| Exact Mass | 312.16000 |
| PSA | 40.62000 |
| LogP | 2.75740 |
| Vapour Pressure | 7.5E-07mmHg at 25°C |
| Index of Refraction | 1.525 |
| InChIKey | QTSWJVXKVCHRPC-UHFFFAOYSA-N |
| SMILES | CN(C)CCC(=O)c1ccc(C(=O)CCN(C)C)cc1.Cl |
|
~%
3-dimethylamino... CAS#:21702-05-6 |
| Literature: Smith Kline and French Laboratories Limited Patent: US4904664 A1, 1990 ; |
|
~71%
3-dimethylamino... CAS#:21702-05-6 |
| Literature: Coates, William J.; Prain, H. Douglas; Reeves, Martin L.; Warrington, Brian H. Journal of Medicinal Chemistry, 1990 , vol. 33, # 6 p. 1735 - 1741 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 1,4-bis(3-dimethylamino-1-propionyl)benzene dihydrochloride |
| 1,4-Bis(3'-dimethylamino-propionyl)-benzol-dihydrochlorid |