2,5,7,8-tetramethyl-3,4-dihydro-2H-chromen-6-ol structure
|
Common Name | 2,5,7,8-tetramethyl-3,4-dihydro-2H-chromen-6-ol | ||
|---|---|---|---|---|
| CAS Number | 21704-71-2 | Molecular Weight | 206.28100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H18O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2,5,7,8-tetramethyl-3,4-dihydro-2H-chromen-6-ol |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H18O2 |
|---|---|
| Molecular Weight | 206.28100 |
| Exact Mass | 206.13100 |
| PSA | 29.46000 |
| LogP | 3.03090 |
| InChIKey | PYQVCYCHUWIDIS-UHFFFAOYSA-N |
| SMILES | Cc1c(C)c2c(c(C)c1O)CCC(C)O2 |
|
~%
2,5,7,8-tetrame... CAS#:21704-71-2 |
| Literature: Smith; Carlin Journal of the American Chemical Society, 1942 , vol. 64, p. 435,437 |
|
~%
2,5,7,8-tetrame... CAS#:21704-71-2 |
| Literature: Smith; Carlin Journal of the American Chemical Society, 1942 , vol. 64, p. 435,437 |
|
~%
2,5,7,8-tetrame... CAS#:21704-71-2 |
| Literature: Smith; Carlin Journal of the American Chemical Society, 1942 , vol. 64, p. 435,437 |
|
~%
2,5,7,8-tetrame... CAS#:21704-71-2 |
| Literature: John; Guenther Chemische Berichte, 1939 , vol. 72, p. 1649,1652 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 2,5,7,8-tetramethyl-6-hydroxychroman |
| 2H-1-Benzopyran-6-ol,3,4-dihydro-2,5,7,8-tetramethyl |
| 2,5,7,8-Tetramethyl-chroman-6-ol |