1-Amino-3,6,9,12,15,18,21,24,27,30-decaoxatritriacontan-33-oic acid structure
|
Common Name | 1-Amino-3,6,9,12,15,18,21,24,27,30-decaoxatritriacontan-33-oic acid | ||
|---|---|---|---|---|
| CAS Number | 2170987-85-4 | Molecular Weight | 529.62 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C23H47NO12 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of 1-Amino-3,6,9,12,15,18,21,24,27,30-decaoxatritriacontan-33-oic acidAmino-PEG10-acid is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
| Name | Amino-PEG10-acid |
|---|
| Description | Amino-PEG10-acid is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
|---|---|
| Related Catalog | |
| Target |
PEGs |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1]. |
| References |
| Molecular Formula | C23H47NO12 |
|---|---|
| Molecular Weight | 529.62 |
| InChIKey | SVXUSQJNNODUGC-UHFFFAOYSA-N |
| SMILES | NCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCC(=O)O |