5-[(2R)-N-ethyl-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)pentanamido]pentanoic acid structure
|
Common Name | 5-[(2R)-N-ethyl-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)pentanamido]pentanoic acid | ||
|---|---|---|---|---|
| CAS Number | 2171172-37-3 | Molecular Weight | 466.6 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C27H34N2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 5-[(2R)-N-ethyl-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)pentanamido]pentanoic acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C27H34N2O5 |
|---|---|
| Molecular Weight | 466.6 |
| InChIKey | XFNCUCWXFKJAHN-XMMPIXPASA-N |
| SMILES | CCCC(NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)N(CC)CCCCC(=O)O |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 5-[(2R)-N-ethyl-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)pentanamido]pentanoic acid? |
| A: Molecular formula of 5-[(2R)-N-ethyl-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)pentanamido]pentanoic acid is C27H34N2O5. |
| Q: What is the English name of 5-[(2R)-N-ethyl-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)pentanamido]pentanoic acid? |
| A: The English name of 5-[(2R)-N-ethyl-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)pentanamido]pentanoic acid is 5-[(2R)-N-ethyl-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)pentanamido]pentanoic acid. |
| Q: What is the Chinese name of 2171172-37-3? |
| A: Chinese name of 2171172-37-3 is 2171172-37-3. |
| Q: What is the SMILES notation of 5-[(2R)-N-ethyl-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)pentanamido]pentanoic acid? |
| A: SMILES notation of 5-[(2R)-N-ethyl-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)pentanamido]pentanoic acid is CCCC(NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)N(CC)CCCCC(=O)O. |
| Q: What is the CAS number of 5-[(2R)-N-ethyl-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)pentanamido]pentanoic acid? |
| A: CAS number of 5-[(2R)-N-ethyl-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)pentanamido]pentanoic acid is 2171172-37-3. |
| Q: What is the InChIKey of 5-[(2R)-N-ethyl-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)pentanamido]pentanoic acid? |
| A: InChIKey of 5-[(2R)-N-ethyl-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)pentanamido]pentanoic acid is XFNCUCWXFKJAHN-XMMPIXPASA-N. |
| Q: What is the molecular weight of 5-[(2R)-N-ethyl-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)pentanamido]pentanoic acid? |
| A: Molecular weight of 5-[(2R)-N-ethyl-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)pentanamido]pentanoic acid is 466.6. |