4-[(2R)-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)propanamido]but-2-enoic acid
Modify Date: 2025-09-18 17:38:42
![4-[(2R)-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)propanamido]but-2-enoic acid Structure](https://www.chemsrc.com/extcaspic/061/2171237-63-9.png)
4-[(2R)-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)propanamido]but-2-enoic acid structure
|
Common Name | 4-[(2R)-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)propanamido]but-2-enoic acid | ||
|---|---|---|---|---|
| CAS Number | 2171237-63-9 | Molecular Weight | 394.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H22N2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-[(2R)-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)propanamido]but-2-enoic acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C22H22N2O5 |
|---|---|
| Molecular Weight | 394.4 |
| InChIKey | INZLOWUEWYRXEV-JBNJFFQFSA-N |
| SMILES | CC(NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)NCC=CC(=O)O |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 4-[(2R)-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)propanamido]but-2-enoic acid? |
| A: Molecular formula of 4-[(2R)-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)propanamido]but-2-enoic acid is C22H22N2O5. |
| Q: What is the molecular weight of 4-[(2R)-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)propanamido]but-2-enoic acid? |
| A: Molecular weight of 4-[(2R)-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)propanamido]but-2-enoic acid is 394.4. |
| Q: What is the English name of 4-[(2R)-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)propanamido]but-2-enoic acid? |
| A: The English name of 4-[(2R)-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)propanamido]but-2-enoic acid is 4-[(2R)-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)propanamido]but-2-enoic acid. |
| Q: What is the SMILES notation of 4-[(2R)-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)propanamido]but-2-enoic acid? |
| A: SMILES notation of 4-[(2R)-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)propanamido]but-2-enoic acid is CC(NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)NCC=CC(=O)O. |
| Q: What is the Chinese name of 2171237-63-9? |
| A: Chinese name of 2171237-63-9 is 2171237-63-9. |
| Q: What is the CAS number of 4-[(2R)-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)propanamido]but-2-enoic acid? |
| A: CAS number of 4-[(2R)-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)propanamido]but-2-enoic acid is 2171237-63-9. |
| Q: What is the InChIKey of 4-[(2R)-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)propanamido]but-2-enoic acid? |
| A: InChIKey of 4-[(2R)-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)propanamido]but-2-enoic acid is INZLOWUEWYRXEV-JBNJFFQFSA-N. |