2-{[(2R)-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)butanamido]oxy}acetic acid
Modify Date: 2026-08-03 09:48:49
![2-{[(2R)-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)butanamido]oxy}acetic acid Structure](https://www.chemsrc.com/extcaspic/361/2171237-68-4.png)
2-{[(2R)-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)butanamido]oxy}acetic acid structure
|
Common Name | 2-{[(2R)-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)butanamido]oxy}acetic acid | ||
|---|---|---|---|---|
| CAS Number | 2171237-68-4 | Molecular Weight | 398.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H22N2O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-{[(2R)-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)butanamido]oxy}acetic acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C21H22N2O6 |
|---|---|
| Molecular Weight | 398.4 |
| InChIKey | RRAQPVBZDOQVMN-GOSISDBHSA-N |
| SMILES | CCC(NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)NOCC(=O)O |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 2-{[(2R)-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)butanamido]oxy}acetic acid? |
| A: Molecular weight of 2-{[(2R)-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)butanamido]oxy}acetic acid is 398.4. |
| Q: What is the molecular formula of 2-{[(2R)-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)butanamido]oxy}acetic acid? |
| A: Molecular formula of 2-{[(2R)-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)butanamido]oxy}acetic acid is C21H22N2O6. |
| Q: What is the Chinese name of 2171237-68-4? |
| A: Chinese name of 2171237-68-4 is 2171237-68-4. |
| Q: What is the English name of 2-{[(2R)-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)butanamido]oxy}acetic acid? |
| A: The English name of 2-{[(2R)-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)butanamido]oxy}acetic acid is 2-{[(2R)-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)butanamido]oxy}acetic acid. |
| Q: What is the InChIKey of 2-{[(2R)-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)butanamido]oxy}acetic acid? |
| A: InChIKey of 2-{[(2R)-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)butanamido]oxy}acetic acid is RRAQPVBZDOQVMN-GOSISDBHSA-N. |
| Q: What is the CAS number of 2-{[(2R)-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)butanamido]oxy}acetic acid? |
| A: CAS number of 2-{[(2R)-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)butanamido]oxy}acetic acid is 2171237-68-4. |
| Q: What is the SMILES notation of 2-{[(2R)-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)butanamido]oxy}acetic acid? |
| A: SMILES notation of 2-{[(2R)-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)butanamido]oxy}acetic acid is CCC(NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)NOCC(=O)O. |