2-[(3R)-N-cyclopropyl-3-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)pentanamido]acetic acid structure
|
Common Name | 2-[(3R)-N-cyclopropyl-3-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)pentanamido]acetic acid | ||
|---|---|---|---|---|
| CAS Number | 2171245-93-3 | Molecular Weight | 436.5 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C25H28N2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-[(3R)-N-cyclopropyl-3-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)pentanamido]acetic acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C25H28N2O5 |
|---|---|
| Molecular Weight | 436.5 |
| InChIKey | GEIJFGMVEMOTKM-MRXNPFEDSA-N |
| SMILES | CCC(CC(=O)N(CC(=O)O)C1CC1)NC(=O)OCC1c2ccccc2-c2ccccc21 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 2-[(3R)-N-cyclopropyl-3-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)pentanamido]acetic acid? |
| A: The English name of 2-[(3R)-N-cyclopropyl-3-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)pentanamido]acetic acid is 2-[(3R)-N-cyclopropyl-3-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)pentanamido]acetic acid. |
| Q: What is the molecular weight of 2-[(3R)-N-cyclopropyl-3-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)pentanamido]acetic acid? |
| A: Molecular weight of 2-[(3R)-N-cyclopropyl-3-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)pentanamido]acetic acid is 436.5. |
| Q: What is the InChIKey of 2-[(3R)-N-cyclopropyl-3-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)pentanamido]acetic acid? |
| A: InChIKey of 2-[(3R)-N-cyclopropyl-3-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)pentanamido]acetic acid is GEIJFGMVEMOTKM-MRXNPFEDSA-N. |
| Q: What is the SMILES notation of 2-[(3R)-N-cyclopropyl-3-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)pentanamido]acetic acid? |
| A: SMILES notation of 2-[(3R)-N-cyclopropyl-3-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)pentanamido]acetic acid is CCC(CC(=O)N(CC(=O)O)C1CC1)NC(=O)OCC1c2ccccc2-c2ccccc21. |
| Q: What is the molecular formula of 2-[(3R)-N-cyclopropyl-3-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)pentanamido]acetic acid? |
| A: Molecular formula of 2-[(3R)-N-cyclopropyl-3-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)pentanamido]acetic acid is C25H28N2O5. |
| Q: What is the CAS number of 2-[(3R)-N-cyclopropyl-3-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)pentanamido]acetic acid? |
| A: CAS number of 2-[(3R)-N-cyclopropyl-3-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)pentanamido]acetic acid is 2171245-93-3. |
| Q: What is the Chinese name of 2171245-93-3? |
| A: Chinese name of 2171245-93-3 is 2171245-93-3. |