Methacrylic acid 3-diethylamino-2-hydroxypropyl ester structure
|
Common Name | Methacrylic acid 3-diethylamino-2-hydroxypropyl ester | ||
|---|---|---|---|---|
| CAS Number | 21714-01-2 | Molecular Weight | 215.28900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H21NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | [3-(diethylamino)-2-hydroxypropyl] 2-methylprop-2-enoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C11H21NO3 |
|---|---|
| Molecular Weight | 215.28900 |
| Exact Mass | 215.15200 |
| PSA | 49.77000 |
| LogP | 0.80840 |
| InChIKey | IWBDFGGFMHTJNJ-UHFFFAOYSA-N |
| SMILES | C=C(C)C(=O)OCC(O)CN(CC)CC |
| HS Code | 2922509090 |
|---|
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Methacrylic acid 3-diethylamino-2-hydroxypropyl ester |
| 2-Propenoic acid,2-methyl-,3-(diethylamino)-2-hydroxypropyl ester |