(3R)-3-[4-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)-3-methylbutanamido]pentanoic acid
Modify Date: 2025-11-05 18:13:01
![(3R)-3-[4-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)-3-methylbutanamido]pentanoic acid Structure](https://www.chemsrc.com/extcaspic/021/2171443-58-4.png)
(3R)-3-[4-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)-3-methylbutanamido]pentanoic acid structure
|
Common Name | (3R)-3-[4-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)-3-methylbutanamido]pentanoic acid | ||
|---|---|---|---|---|
| CAS Number | 2171443-58-4 | Molecular Weight | 438.5 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C25H30N2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (3R)-3-[4-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)-3-methylbutanamido]pentanoic acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C25H30N2O5 |
|---|---|
| Molecular Weight | 438.5 |
| InChIKey | IGMKGBBHQMFACE-ZYMOGRSISA-N |
| SMILES | CCC(CC(=O)O)NC(=O)CC(C)CNC(=O)OCC1c2ccccc2-c2ccccc21 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of (3R)-3-[4-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)-3-methylbutanamido]pentanoic acid? |
| A: The English name of (3R)-3-[4-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)-3-methylbutanamido]pentanoic acid is (3R)-3-[4-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)-3-methylbutanamido]pentanoic acid. |
| Q: What is the SMILES notation of (3R)-3-[4-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)-3-methylbutanamido]pentanoic acid? |
| A: SMILES notation of (3R)-3-[4-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)-3-methylbutanamido]pentanoic acid is CCC(CC(=O)O)NC(=O)CC(C)CNC(=O)OCC1c2ccccc2-c2ccccc21. |
| Q: What is the InChIKey of (3R)-3-[4-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)-3-methylbutanamido]pentanoic acid? |
| A: InChIKey of (3R)-3-[4-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)-3-methylbutanamido]pentanoic acid is IGMKGBBHQMFACE-ZYMOGRSISA-N. |
| Q: What is the CAS number of (3R)-3-[4-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)-3-methylbutanamido]pentanoic acid? |
| A: CAS number of (3R)-3-[4-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)-3-methylbutanamido]pentanoic acid is 2171443-58-4. |
| Q: What is the Chinese name of 2171443-58-4? |
| A: Chinese name of 2171443-58-4 is 2171443-58-4. |
| Q: What is the molecular weight of (3R)-3-[4-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)-3-methylbutanamido]pentanoic acid? |
| A: Molecular weight of (3R)-3-[4-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)-3-methylbutanamido]pentanoic acid is 438.5. |
| Q: What is the molecular formula of (3R)-3-[4-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)-3-methylbutanamido]pentanoic acid? |
| A: Molecular formula of (3R)-3-[4-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)-3-methylbutanamido]pentanoic acid is C25H30N2O5. |