10-(3,3-Dimethylbutyl)-6-oxa-2-thia-9-azaspiro[4.5]decane structure
|
Common Name | 10-(3,3-Dimethylbutyl)-6-oxa-2-thia-9-azaspiro[4.5]decane | ||
|---|---|---|---|---|
| CAS Number | 2171527-86-7 | Molecular Weight | 243.41 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H25NOS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 10-(3,3-Dimethylbutyl)-6-oxa-2-thia-9-azaspiro[4.5]decane |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H25NOS |
|---|---|
| Molecular Weight | 243.41 |
| InChIKey | LPWZYOBLZITDDN-UHFFFAOYSA-N |
| SMILES | CC(C)(C)CCC1NCCOC12CCSC2 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 10-(3,3-Dimethylbutyl)-6-oxa-2-thia-9-azaspiro[4.5]decane? |
| A: Molecular weight of 10-(3,3-Dimethylbutyl)-6-oxa-2-thia-9-azaspiro[4.5]decane is 243.41. |
| Q: What is the molecular formula of 10-(3,3-Dimethylbutyl)-6-oxa-2-thia-9-azaspiro[4.5]decane? |
| A: Molecular formula of 10-(3,3-Dimethylbutyl)-6-oxa-2-thia-9-azaspiro[4.5]decane is C13H25NOS. |
| Q: What is the InChIKey of 10-(3,3-Dimethylbutyl)-6-oxa-2-thia-9-azaspiro[4.5]decane? |
| A: InChIKey of 10-(3,3-Dimethylbutyl)-6-oxa-2-thia-9-azaspiro[4.5]decane is LPWZYOBLZITDDN-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 2171527-86-7? |
| A: Chinese name of 2171527-86-7 is 2171527-86-7. |
| Q: What is the CAS number of 10-(3,3-Dimethylbutyl)-6-oxa-2-thia-9-azaspiro[4.5]decane? |
| A: CAS number of 10-(3,3-Dimethylbutyl)-6-oxa-2-thia-9-azaspiro[4.5]decane is 2171527-86-7. |
| Q: What is the SMILES notation of 10-(3,3-Dimethylbutyl)-6-oxa-2-thia-9-azaspiro[4.5]decane? |
| A: SMILES notation of 10-(3,3-Dimethylbutyl)-6-oxa-2-thia-9-azaspiro[4.5]decane is CC(C)(C)CCC1NCCOC12CCSC2. |
| Q: What is the English name of 10-(3,3-Dimethylbutyl)-6-oxa-2-thia-9-azaspiro[4.5]decane? |
| A: The English name of 10-(3,3-Dimethylbutyl)-6-oxa-2-thia-9-azaspiro[4.5]decane is 10-(3,3-Dimethylbutyl)-6-oxa-2-thia-9-azaspiro[4.5]decane. |