8,10-Dimethyl-5-[(propan-2-yloxy)methyl]-1-oxa-4-azaspiro[5.5]undecane
Modify Date: 2026-07-02 07:46:51
![8,10-Dimethyl-5-[(propan-2-yloxy)methyl]-1-oxa-4-azaspiro[5.5]undecane Structure](https://www.chemsrc.com/extcaspic/097/2171608-39-0.png)
8,10-Dimethyl-5-[(propan-2-yloxy)methyl]-1-oxa-4-azaspiro[5.5]undecane structure
|
Common Name | 8,10-Dimethyl-5-[(propan-2-yloxy)methyl]-1-oxa-4-azaspiro[5.5]undecane | ||
|---|---|---|---|---|
| CAS Number | 2171608-39-0 | Molecular Weight | 255.40 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H29NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 8,10-Dimethyl-5-[(propan-2-yloxy)methyl]-1-oxa-4-azaspiro[5.5]undecane |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C15H29NO2 |
|---|---|
| Molecular Weight | 255.40 |
| InChIKey | JATFKOQGWHACPL-UHFFFAOYSA-N |
| SMILES | CC1CC(C)CC2(C1)OCCNC2COC(C)C |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 2171608-39-0? |
| A: Chinese name of 2171608-39-0 is 2171608-39-0. |
| Q: What is the molecular weight of 8,10-Dimethyl-5-[(propan-2-yloxy)methyl]-1-oxa-4-azaspiro[5.5]undecane? |
| A: Molecular weight of 8,10-Dimethyl-5-[(propan-2-yloxy)methyl]-1-oxa-4-azaspiro[5.5]undecane is 255.40. |
| Q: What is the CAS number of 8,10-Dimethyl-5-[(propan-2-yloxy)methyl]-1-oxa-4-azaspiro[5.5]undecane? |
| A: CAS number of 8,10-Dimethyl-5-[(propan-2-yloxy)methyl]-1-oxa-4-azaspiro[5.5]undecane is 2171608-39-0. |
| Q: What is the English name of 8,10-Dimethyl-5-[(propan-2-yloxy)methyl]-1-oxa-4-azaspiro[5.5]undecane? |
| A: The English name of 8,10-Dimethyl-5-[(propan-2-yloxy)methyl]-1-oxa-4-azaspiro[5.5]undecane is 8,10-Dimethyl-5-[(propan-2-yloxy)methyl]-1-oxa-4-azaspiro[5.5]undecane. |
| Q: What is the molecular formula of 8,10-Dimethyl-5-[(propan-2-yloxy)methyl]-1-oxa-4-azaspiro[5.5]undecane? |
| A: Molecular formula of 8,10-Dimethyl-5-[(propan-2-yloxy)methyl]-1-oxa-4-azaspiro[5.5]undecane is C15H29NO2. |
| Q: What is the InChIKey of 8,10-Dimethyl-5-[(propan-2-yloxy)methyl]-1-oxa-4-azaspiro[5.5]undecane? |
| A: InChIKey of 8,10-Dimethyl-5-[(propan-2-yloxy)methyl]-1-oxa-4-azaspiro[5.5]undecane is JATFKOQGWHACPL-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of 8,10-Dimethyl-5-[(propan-2-yloxy)methyl]-1-oxa-4-azaspiro[5.5]undecane? |
| A: SMILES notation of 8,10-Dimethyl-5-[(propan-2-yloxy)methyl]-1-oxa-4-azaspiro[5.5]undecane is CC1CC(C)CC2(C1)OCCNC2COC(C)C. |