13-(Methoxymethyl)-1,4,9-trioxa-12-azadispiro[4.2.5^{8}.2^{5}]pentadecane
Modify Date: 2025-09-17 19:17:10
![13-(Methoxymethyl)-1,4,9-trioxa-12-azadispiro[4.2.5^{8}.2^{5}]pentadecane Structure](https://www.chemsrc.com/extcaspic/490/2171626-48-3.png)
13-(Methoxymethyl)-1,4,9-trioxa-12-azadispiro[4.2.5^{8}.2^{5}]pentadecane structure
|
Common Name | 13-(Methoxymethyl)-1,4,9-trioxa-12-azadispiro[4.2.5^{8}.2^{5}]pentadecane | ||
|---|---|---|---|---|
| CAS Number | 2171626-48-3 | Molecular Weight | 257.33 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H23NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 13-(Methoxymethyl)-1,4,9-trioxa-12-azadispiro[4.2.5^{8}.2^{5}]pentadecane |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H23NO4 |
|---|---|
| Molecular Weight | 257.33 |
| InChIKey | XOGRFMCBQKTFSZ-UHFFFAOYSA-N |
| SMILES | COCC1NCCOC12CCC1(CC2)OCCO1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 13-(Methoxymethyl)-1,4,9-trioxa-12-azadispiro[4.2.5^{8}.2^{5}]pentadecane? |
| A: SMILES notation of 13-(Methoxymethyl)-1,4,9-trioxa-12-azadispiro[4.2.5^{8}.2^{5}]pentadecane is COCC1NCCOC12CCC1(CC2)OCCO1. |
| Q: What is the CAS number of 13-(Methoxymethyl)-1,4,9-trioxa-12-azadispiro[4.2.5^{8}.2^{5}]pentadecane? |
| A: CAS number of 13-(Methoxymethyl)-1,4,9-trioxa-12-azadispiro[4.2.5^{8}.2^{5}]pentadecane is 2171626-48-3. |
| Q: What is the English name of 13-(Methoxymethyl)-1,4,9-trioxa-12-azadispiro[4.2.5^{8}.2^{5}]pentadecane? |
| A: The English name of 13-(Methoxymethyl)-1,4,9-trioxa-12-azadispiro[4.2.5^{8}.2^{5}]pentadecane is 13-(Methoxymethyl)-1,4,9-trioxa-12-azadispiro[4.2.5^{8}.2^{5}]pentadecane. |
| Q: What is the Chinese name of 2171626-48-3? |
| A: Chinese name of 2171626-48-3 is 2171626-48-3. |
| Q: What is the molecular weight of 13-(Methoxymethyl)-1,4,9-trioxa-12-azadispiro[4.2.5^{8}.2^{5}]pentadecane? |
| A: Molecular weight of 13-(Methoxymethyl)-1,4,9-trioxa-12-azadispiro[4.2.5^{8}.2^{5}]pentadecane is 257.33. |
| Q: What is the molecular formula of 13-(Methoxymethyl)-1,4,9-trioxa-12-azadispiro[4.2.5^{8}.2^{5}]pentadecane? |
| A: Molecular formula of 13-(Methoxymethyl)-1,4,9-trioxa-12-azadispiro[4.2.5^{8}.2^{5}]pentadecane is C13H23NO4. |
| Q: What is the InChIKey of 13-(Methoxymethyl)-1,4,9-trioxa-12-azadispiro[4.2.5^{8}.2^{5}]pentadecane? |
| A: InChIKey of 13-(Methoxymethyl)-1,4,9-trioxa-12-azadispiro[4.2.5^{8}.2^{5}]pentadecane is XOGRFMCBQKTFSZ-UHFFFAOYSA-N. |