9-[(2,6-Dimethyloxan-4-yl)methyl]-5-oxa-2,8-diazaspiro[3.5]nonane
Modify Date: 2026-07-16 11:06:49
![9-[(2,6-Dimethyloxan-4-yl)methyl]-5-oxa-2,8-diazaspiro[3.5]nonane Structure](https://www.chemsrc.com/extcaspic/357/2171634-85-6.png)
9-[(2,6-Dimethyloxan-4-yl)methyl]-5-oxa-2,8-diazaspiro[3.5]nonane structure
|
Common Name | 9-[(2,6-Dimethyloxan-4-yl)methyl]-5-oxa-2,8-diazaspiro[3.5]nonane | ||
|---|---|---|---|---|
| CAS Number | 2171634-85-6 | Molecular Weight | 254.37 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H26N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 9-[(2,6-Dimethyloxan-4-yl)methyl]-5-oxa-2,8-diazaspiro[3.5]nonane |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H26N2O2 |
|---|---|
| Molecular Weight | 254.37 |
| InChIKey | XESLFCNVNKWQEQ-UHFFFAOYSA-N |
| SMILES | CC1CC(CC2NCCOC23CNC3)CC(C)O1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 9-[(2,6-Dimethyloxan-4-yl)methyl]-5-oxa-2,8-diazaspiro[3.5]nonane? |
| A: Molecular weight of 9-[(2,6-Dimethyloxan-4-yl)methyl]-5-oxa-2,8-diazaspiro[3.5]nonane is 254.37. |
| Q: What is the InChIKey of 9-[(2,6-Dimethyloxan-4-yl)methyl]-5-oxa-2,8-diazaspiro[3.5]nonane? |
| A: InChIKey of 9-[(2,6-Dimethyloxan-4-yl)methyl]-5-oxa-2,8-diazaspiro[3.5]nonane is XESLFCNVNKWQEQ-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 9-[(2,6-Dimethyloxan-4-yl)methyl]-5-oxa-2,8-diazaspiro[3.5]nonane? |
| A: Molecular formula of 9-[(2,6-Dimethyloxan-4-yl)methyl]-5-oxa-2,8-diazaspiro[3.5]nonane is C14H26N2O2. |
| Q: What is the SMILES notation of 9-[(2,6-Dimethyloxan-4-yl)methyl]-5-oxa-2,8-diazaspiro[3.5]nonane? |
| A: SMILES notation of 9-[(2,6-Dimethyloxan-4-yl)methyl]-5-oxa-2,8-diazaspiro[3.5]nonane is CC1CC(CC2NCCOC23CNC3)CC(C)O1. |
| Q: What is the English name of 9-[(2,6-Dimethyloxan-4-yl)methyl]-5-oxa-2,8-diazaspiro[3.5]nonane? |
| A: The English name of 9-[(2,6-Dimethyloxan-4-yl)methyl]-5-oxa-2,8-diazaspiro[3.5]nonane is 9-[(2,6-Dimethyloxan-4-yl)methyl]-5-oxa-2,8-diazaspiro[3.5]nonane. |
| Q: What is the Chinese name of 2171634-85-6? |
| A: Chinese name of 2171634-85-6 is 2171634-85-6. |
| Q: What is the CAS number of 9-[(2,6-Dimethyloxan-4-yl)methyl]-5-oxa-2,8-diazaspiro[3.5]nonane? |
| A: CAS number of 9-[(2,6-Dimethyloxan-4-yl)methyl]-5-oxa-2,8-diazaspiro[3.5]nonane is 2171634-85-6. |