3'-Propyl-8lambda6-thiaspiro[bicyclo[3.2.1]octane-3,2'-morpholine]-8,8-dione
Modify Date: 2026-08-04 14:53:32
![3'-Propyl-8lambda6-thiaspiro[bicyclo[3.2.1]octane-3,2'-morpholine]-8,8-dione Structure](https://www.chemsrc.com/extcaspic/371/2171652-42-7.png)
3'-Propyl-8lambda6-thiaspiro[bicyclo[3.2.1]octane-3,2'-morpholine]-8,8-dione structure
|
Common Name | 3'-Propyl-8lambda6-thiaspiro[bicyclo[3.2.1]octane-3,2'-morpholine]-8,8-dione | ||
|---|---|---|---|---|
| CAS Number | 2171652-42-7 | Molecular Weight | 273.39 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H23NO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3'-Propyl-8lambda6-thiaspiro[bicyclo[3.2.1]octane-3,2'-morpholine]-8,8-dione |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H23NO3S |
|---|---|
| Molecular Weight | 273.39 |
| InChIKey | SNFUSEOJHJPIKM-UHFFFAOYSA-N |
| SMILES | CCCC1NCCOC12CC1CCC(C2)S1(=O)=O |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 3'-Propyl-8lambda6-thiaspiro[bicyclo[3.2.1]octane-3,2'-morpholine]-8,8-dione? |
| A: The English name of 3'-Propyl-8lambda6-thiaspiro[bicyclo[3.2.1]octane-3,2'-morpholine]-8,8-dione is 3'-Propyl-8lambda6-thiaspiro[bicyclo[3.2.1]octane-3,2'-morpholine]-8,8-dione. |
| Q: What is the molecular formula of 3'-Propyl-8lambda6-thiaspiro[bicyclo[3.2.1]octane-3,2'-morpholine]-8,8-dione? |
| A: Molecular formula of 3'-Propyl-8lambda6-thiaspiro[bicyclo[3.2.1]octane-3,2'-morpholine]-8,8-dione is C13H23NO3S. |
| Q: What is the Chinese name of 2171652-42-7? |
| A: Chinese name of 2171652-42-7 is 2171652-42-7. |
| Q: What is the CAS number of 3'-Propyl-8lambda6-thiaspiro[bicyclo[3.2.1]octane-3,2'-morpholine]-8,8-dione? |
| A: CAS number of 3'-Propyl-8lambda6-thiaspiro[bicyclo[3.2.1]octane-3,2'-morpholine]-8,8-dione is 2171652-42-7. |
| Q: What is the InChIKey of 3'-Propyl-8lambda6-thiaspiro[bicyclo[3.2.1]octane-3,2'-morpholine]-8,8-dione? |
| A: InChIKey of 3'-Propyl-8lambda6-thiaspiro[bicyclo[3.2.1]octane-3,2'-morpholine]-8,8-dione is SNFUSEOJHJPIKM-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of 3'-Propyl-8lambda6-thiaspiro[bicyclo[3.2.1]octane-3,2'-morpholine]-8,8-dione? |
| A: SMILES notation of 3'-Propyl-8lambda6-thiaspiro[bicyclo[3.2.1]octane-3,2'-morpholine]-8,8-dione is CCCC1NCCOC12CC1CCC(C2)S1(=O)=O. |
| Q: What is the molecular weight of 3'-Propyl-8lambda6-thiaspiro[bicyclo[3.2.1]octane-3,2'-morpholine]-8,8-dione? |
| A: Molecular weight of 3'-Propyl-8lambda6-thiaspiro[bicyclo[3.2.1]octane-3,2'-morpholine]-8,8-dione is 273.39. |