10-(2,2-Dimethylbutyl)-6-oxa-2lambda6-thia-9-azaspiro[4.5]decane-2,2-dione
Modify Date: 2026-09-28 14:28:15
![10-(2,2-Dimethylbutyl)-6-oxa-2lambda6-thia-9-azaspiro[4.5]decane-2,2-dione Structure](https://www.chemsrc.com/extcaspic/011/2171756-64-0.png)
10-(2,2-Dimethylbutyl)-6-oxa-2lambda6-thia-9-azaspiro[4.5]decane-2,2-dione structure
|
Common Name | 10-(2,2-Dimethylbutyl)-6-oxa-2lambda6-thia-9-azaspiro[4.5]decane-2,2-dione | ||
|---|---|---|---|---|
| CAS Number | 2171756-64-0 | Molecular Weight | 275.41 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H25NO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 10-(2,2-Dimethylbutyl)-6-oxa-2lambda6-thia-9-azaspiro[4.5]decane-2,2-dione |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H25NO3S |
|---|---|
| Molecular Weight | 275.41 |
| InChIKey | XJOHURTZTJJCQT-UHFFFAOYSA-N |
| SMILES | CCC(C)(C)CC1NCCOC12CCS(=O)(=O)C2 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 10-(2,2-Dimethylbutyl)-6-oxa-2lambda6-thia-9-azaspiro[4.5]decane-2,2-dione? |
| A: The English name of 10-(2,2-Dimethylbutyl)-6-oxa-2lambda6-thia-9-azaspiro[4.5]decane-2,2-dione is 10-(2,2-Dimethylbutyl)-6-oxa-2lambda6-thia-9-azaspiro[4.5]decane-2,2-dione. |
| Q: What is the SMILES notation of 10-(2,2-Dimethylbutyl)-6-oxa-2lambda6-thia-9-azaspiro[4.5]decane-2,2-dione? |
| A: SMILES notation of 10-(2,2-Dimethylbutyl)-6-oxa-2lambda6-thia-9-azaspiro[4.5]decane-2,2-dione is CCC(C)(C)CC1NCCOC12CCS(=O)(=O)C2. |
| Q: What is the InChIKey of 10-(2,2-Dimethylbutyl)-6-oxa-2lambda6-thia-9-azaspiro[4.5]decane-2,2-dione? |
| A: InChIKey of 10-(2,2-Dimethylbutyl)-6-oxa-2lambda6-thia-9-azaspiro[4.5]decane-2,2-dione is XJOHURTZTJJCQT-UHFFFAOYSA-N. |
| Q: What is the CAS number of 10-(2,2-Dimethylbutyl)-6-oxa-2lambda6-thia-9-azaspiro[4.5]decane-2,2-dione? |
| A: CAS number of 10-(2,2-Dimethylbutyl)-6-oxa-2lambda6-thia-9-azaspiro[4.5]decane-2,2-dione is 2171756-64-0. |
| Q: What is the molecular formula of 10-(2,2-Dimethylbutyl)-6-oxa-2lambda6-thia-9-azaspiro[4.5]decane-2,2-dione? |
| A: Molecular formula of 10-(2,2-Dimethylbutyl)-6-oxa-2lambda6-thia-9-azaspiro[4.5]decane-2,2-dione is C13H25NO3S. |
| Q: What is the molecular weight of 10-(2,2-Dimethylbutyl)-6-oxa-2lambda6-thia-9-azaspiro[4.5]decane-2,2-dione? |
| A: Molecular weight of 10-(2,2-Dimethylbutyl)-6-oxa-2lambda6-thia-9-azaspiro[4.5]decane-2,2-dione is 275.41. |
| Q: What is the Chinese name of 2171756-64-0? |
| A: Chinese name of 2171756-64-0 is 2171756-64-0. |