5-(Oxan-4-yl)-1,8-dioxa-4-azaspiro[5.5]undecane
Modify Date: 2025-10-05 20:30:21
![5-(Oxan-4-yl)-1,8-dioxa-4-azaspiro[5.5]undecane Structure](https://www.chemsrc.com/extcaspic/479/2171778-47-3.png)
5-(Oxan-4-yl)-1,8-dioxa-4-azaspiro[5.5]undecane structure
|
Common Name | 5-(Oxan-4-yl)-1,8-dioxa-4-azaspiro[5.5]undecane | ||
|---|---|---|---|---|
| CAS Number | 2171778-47-3 | Molecular Weight | 241.33 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H23NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 5-(Oxan-4-yl)-1,8-dioxa-4-azaspiro[5.5]undecane |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H23NO3 |
|---|---|
| Molecular Weight | 241.33 |
| InChIKey | YRPRLILNTXZABI-UHFFFAOYSA-N |
| SMILES | C1COCC2(C1)OCCNC2C1CCOCC1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 5-(Oxan-4-yl)-1,8-dioxa-4-azaspiro[5.5]undecane? |
| A: Molecular weight of 5-(Oxan-4-yl)-1,8-dioxa-4-azaspiro[5.5]undecane is 241.33. |
| Q: What is the CAS number of 5-(Oxan-4-yl)-1,8-dioxa-4-azaspiro[5.5]undecane? |
| A: CAS number of 5-(Oxan-4-yl)-1,8-dioxa-4-azaspiro[5.5]undecane is 2171778-47-3. |
| Q: What is the InChIKey of 5-(Oxan-4-yl)-1,8-dioxa-4-azaspiro[5.5]undecane? |
| A: InChIKey of 5-(Oxan-4-yl)-1,8-dioxa-4-azaspiro[5.5]undecane is YRPRLILNTXZABI-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 5-(Oxan-4-yl)-1,8-dioxa-4-azaspiro[5.5]undecane? |
| A: Molecular formula of 5-(Oxan-4-yl)-1,8-dioxa-4-azaspiro[5.5]undecane is C13H23NO3. |
| Q: What is the Chinese name of 2171778-47-3? |
| A: Chinese name of 2171778-47-3 is 2171778-47-3. |
| Q: What is the SMILES notation of 5-(Oxan-4-yl)-1,8-dioxa-4-azaspiro[5.5]undecane? |
| A: SMILES notation of 5-(Oxan-4-yl)-1,8-dioxa-4-azaspiro[5.5]undecane is C1COCC2(C1)OCCNC2C1CCOCC1. |
| Q: What is the English name of 5-(Oxan-4-yl)-1,8-dioxa-4-azaspiro[5.5]undecane? |
| A: The English name of 5-(Oxan-4-yl)-1,8-dioxa-4-azaspiro[5.5]undecane is 5-(Oxan-4-yl)-1,8-dioxa-4-azaspiro[5.5]undecane. |