3-(3-Hydroxybutyl)-1,1-dioxo-1lambda6-thietane-3-carbaldehyde
Modify Date: 2026-07-13 11:24:43
3-(3-Hydroxybutyl)-1,1-dioxo-1lambda6-thietane-3-carbaldehyde structure
|
Common Name | 3-(3-Hydroxybutyl)-1,1-dioxo-1lambda6-thietane-3-carbaldehyde | ||
|---|---|---|---|---|
| CAS Number | 2171865-98-6 | Molecular Weight | 206.26 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H14O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-(3-Hydroxybutyl)-1,1-dioxo-1lambda6-thietane-3-carbaldehyde |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C8H14O4S |
|---|---|
| Molecular Weight | 206.26 |
| InChIKey | URJYEKCUOKNVPX-UHFFFAOYSA-N |
| SMILES | CC(O)CCC1(C=O)CS(=O)(=O)C1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 2171865-98-6? |
| A: Chinese name of 2171865-98-6 is 2171865-98-6. |
| Q: What is the InChIKey of 3-(3-Hydroxybutyl)-1,1-dioxo-1lambda6-thietane-3-carbaldehyde? |
| A: InChIKey of 3-(3-Hydroxybutyl)-1,1-dioxo-1lambda6-thietane-3-carbaldehyde is URJYEKCUOKNVPX-UHFFFAOYSA-N. |
| Q: What is the CAS number of 3-(3-Hydroxybutyl)-1,1-dioxo-1lambda6-thietane-3-carbaldehyde? |
| A: CAS number of 3-(3-Hydroxybutyl)-1,1-dioxo-1lambda6-thietane-3-carbaldehyde is 2171865-98-6. |
| Q: What is the SMILES notation of 3-(3-Hydroxybutyl)-1,1-dioxo-1lambda6-thietane-3-carbaldehyde? |
| A: SMILES notation of 3-(3-Hydroxybutyl)-1,1-dioxo-1lambda6-thietane-3-carbaldehyde is CC(O)CCC1(C=O)CS(=O)(=O)C1. |
| Q: What is the molecular weight of 3-(3-Hydroxybutyl)-1,1-dioxo-1lambda6-thietane-3-carbaldehyde? |
| A: Molecular weight of 3-(3-Hydroxybutyl)-1,1-dioxo-1lambda6-thietane-3-carbaldehyde is 206.26. |
| Q: What is the molecular formula of 3-(3-Hydroxybutyl)-1,1-dioxo-1lambda6-thietane-3-carbaldehyde? |
| A: Molecular formula of 3-(3-Hydroxybutyl)-1,1-dioxo-1lambda6-thietane-3-carbaldehyde is C8H14O4S. |
| Q: What is the English name of 3-(3-Hydroxybutyl)-1,1-dioxo-1lambda6-thietane-3-carbaldehyde? |
| A: The English name of 3-(3-Hydroxybutyl)-1,1-dioxo-1lambda6-thietane-3-carbaldehyde is 3-(3-Hydroxybutyl)-1,1-dioxo-1lambda6-thietane-3-carbaldehyde. |