9,9,11,11-Tetramethyl-6-oxa-13-azadispiro[3.2.5^{7}.2^{4}]tetradecane
Modify Date: 2025-09-17 19:36:49
![9,9,11,11-Tetramethyl-6-oxa-13-azadispiro[3.2.5^{7}.2^{4}]tetradecane Structure](https://www.chemsrc.com/extcaspic/428/2171876-76-7.png)
9,9,11,11-Tetramethyl-6-oxa-13-azadispiro[3.2.5^{7}.2^{4}]tetradecane structure
|
Common Name | 9,9,11,11-Tetramethyl-6-oxa-13-azadispiro[3.2.5^{7}.2^{4}]tetradecane | ||
|---|---|---|---|---|
| CAS Number | 2171876-76-7 | Molecular Weight | 251.41 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H29NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 9,9,11,11-Tetramethyl-6-oxa-13-azadispiro[3.2.5^{7}.2^{4}]tetradecane |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C16H29NO |
|---|---|
| Molecular Weight | 251.41 |
| InChIKey | YDXLMEBXXQMNCS-UHFFFAOYSA-N |
| SMILES | CC1(C)CC(C)(C)CC2(C1)NCC1(CCC1)CO2 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 9,9,11,11-Tetramethyl-6-oxa-13-azadispiro[3.2.5^{7}.2^{4}]tetradecane? |
| A: SMILES notation of 9,9,11,11-Tetramethyl-6-oxa-13-azadispiro[3.2.5^{7}.2^{4}]tetradecane is CC1(C)CC(C)(C)CC2(C1)NCC1(CCC1)CO2. |
| Q: What is the English name of 9,9,11,11-Tetramethyl-6-oxa-13-azadispiro[3.2.5^{7}.2^{4}]tetradecane? |
| A: The English name of 9,9,11,11-Tetramethyl-6-oxa-13-azadispiro[3.2.5^{7}.2^{4}]tetradecane is 9,9,11,11-Tetramethyl-6-oxa-13-azadispiro[3.2.5^{7}.2^{4}]tetradecane. |
| Q: What is the molecular weight of 9,9,11,11-Tetramethyl-6-oxa-13-azadispiro[3.2.5^{7}.2^{4}]tetradecane? |
| A: Molecular weight of 9,9,11,11-Tetramethyl-6-oxa-13-azadispiro[3.2.5^{7}.2^{4}]tetradecane is 251.41. |
| Q: What is the Chinese name of 2171876-76-7? |
| A: Chinese name of 2171876-76-7 is 2171876-76-7. |
| Q: What is the InChIKey of 9,9,11,11-Tetramethyl-6-oxa-13-azadispiro[3.2.5^{7}.2^{4}]tetradecane? |
| A: InChIKey of 9,9,11,11-Tetramethyl-6-oxa-13-azadispiro[3.2.5^{7}.2^{4}]tetradecane is YDXLMEBXXQMNCS-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 9,9,11,11-Tetramethyl-6-oxa-13-azadispiro[3.2.5^{7}.2^{4}]tetradecane? |
| A: Molecular formula of 9,9,11,11-Tetramethyl-6-oxa-13-azadispiro[3.2.5^{7}.2^{4}]tetradecane is C16H29NO. |
| Q: What is the CAS number of 9,9,11,11-Tetramethyl-6-oxa-13-azadispiro[3.2.5^{7}.2^{4}]tetradecane? |
| A: CAS number of 9,9,11,11-Tetramethyl-6-oxa-13-azadispiro[3.2.5^{7}.2^{4}]tetradecane is 2171876-76-7. |