4,4,6-Triethyl-1,2,3,4-tetrahydronaphthalen-1-amine
Modify Date: 2026-08-19 13:14:01
4,4,6-Triethyl-1,2,3,4-tetrahydronaphthalen-1-amine structure
|
Common Name | 4,4,6-Triethyl-1,2,3,4-tetrahydronaphthalen-1-amine | ||
|---|---|---|---|---|
| CAS Number | 2171908-52-2 | Molecular Weight | 231.38 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H25N | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4,4,6-Triethyl-1,2,3,4-tetrahydronaphthalen-1-amine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C16H25N |
|---|---|
| Molecular Weight | 231.38 |
| InChIKey | GCLLBPRXOVRDCF-UHFFFAOYSA-N |
| SMILES | CCc1ccc2c(c1)C(CC)(CC)CCC2N |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 4,4,6-Triethyl-1,2,3,4-tetrahydronaphthalen-1-amine? |
| A: InChIKey of 4,4,6-Triethyl-1,2,3,4-tetrahydronaphthalen-1-amine is GCLLBPRXOVRDCF-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 4,4,6-Triethyl-1,2,3,4-tetrahydronaphthalen-1-amine? |
| A: Molecular weight of 4,4,6-Triethyl-1,2,3,4-tetrahydronaphthalen-1-amine is 231.38. |
| Q: What is the English name of 4,4,6-Triethyl-1,2,3,4-tetrahydronaphthalen-1-amine? |
| A: The English name of 4,4,6-Triethyl-1,2,3,4-tetrahydronaphthalen-1-amine is 4,4,6-Triethyl-1,2,3,4-tetrahydronaphthalen-1-amine. |
| Q: What is the CAS number of 4,4,6-Triethyl-1,2,3,4-tetrahydronaphthalen-1-amine? |
| A: CAS number of 4,4,6-Triethyl-1,2,3,4-tetrahydronaphthalen-1-amine is 2171908-52-2. |
| Q: What is the SMILES notation of 4,4,6-Triethyl-1,2,3,4-tetrahydronaphthalen-1-amine? |
| A: SMILES notation of 4,4,6-Triethyl-1,2,3,4-tetrahydronaphthalen-1-amine is CCc1ccc2c(c1)C(CC)(CC)CCC2N. |
| Q: What is the Chinese name of 2171908-52-2? |
| A: Chinese name of 2171908-52-2 is 2171908-52-2. |
| Q: What is the molecular formula of 4,4,6-Triethyl-1,2,3,4-tetrahydronaphthalen-1-amine? |
| A: Molecular formula of 4,4,6-Triethyl-1,2,3,4-tetrahydronaphthalen-1-amine is C16H25N. |