2-(2-{4-[(2,2,2-trifluoroethyl)amino]-1H-pyrazol-1-yl}ethoxy)ethan-1-ol
Modify Date: 2025-09-01 14:14:52
![2-(2-{4-[(2,2,2-trifluoroethyl)amino]-1H-pyrazol-1-yl}ethoxy)ethan-1-ol Structure](https://www.chemsrc.com/extcaspic/471/2171968-79-7.png)
2-(2-{4-[(2,2,2-trifluoroethyl)amino]-1H-pyrazol-1-yl}ethoxy)ethan-1-ol structure
|
Common Name | 2-(2-{4-[(2,2,2-trifluoroethyl)amino]-1H-pyrazol-1-yl}ethoxy)ethan-1-ol | ||
|---|---|---|---|---|
| CAS Number | 2171968-79-7 | Molecular Weight | 253.22 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H14F3N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-(2-{4-[(2,2,2-trifluoroethyl)amino]-1H-pyrazol-1-yl}ethoxy)ethan-1-ol |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C9H14F3N3O2 |
|---|---|
| Molecular Weight | 253.22 |
| InChIKey | LZGPVQZMDAMEJG-UHFFFAOYSA-N |
| SMILES | OCCOCCn1cc(NCC(F)(F)F)cn1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 2171968-79-7? |
| A: Chinese name of 2171968-79-7 is 2171968-79-7. |
| Q: What is the SMILES notation of 2-(2-{4-[(2,2,2-trifluoroethyl)amino]-1H-pyrazol-1-yl}ethoxy)ethan-1-ol? |
| A: SMILES notation of 2-(2-{4-[(2,2,2-trifluoroethyl)amino]-1H-pyrazol-1-yl}ethoxy)ethan-1-ol is OCCOCCn1cc(NCC(F)(F)F)cn1. |
| Q: What is the molecular formula of 2-(2-{4-[(2,2,2-trifluoroethyl)amino]-1H-pyrazol-1-yl}ethoxy)ethan-1-ol? |
| A: Molecular formula of 2-(2-{4-[(2,2,2-trifluoroethyl)amino]-1H-pyrazol-1-yl}ethoxy)ethan-1-ol is C9H14F3N3O2. |
| Q: What is the InChIKey of 2-(2-{4-[(2,2,2-trifluoroethyl)amino]-1H-pyrazol-1-yl}ethoxy)ethan-1-ol? |
| A: InChIKey of 2-(2-{4-[(2,2,2-trifluoroethyl)amino]-1H-pyrazol-1-yl}ethoxy)ethan-1-ol is LZGPVQZMDAMEJG-UHFFFAOYSA-N. |
| Q: What is the English name of 2-(2-{4-[(2,2,2-trifluoroethyl)amino]-1H-pyrazol-1-yl}ethoxy)ethan-1-ol? |
| A: The English name of 2-(2-{4-[(2,2,2-trifluoroethyl)amino]-1H-pyrazol-1-yl}ethoxy)ethan-1-ol is 2-(2-{4-[(2,2,2-trifluoroethyl)amino]-1H-pyrazol-1-yl}ethoxy)ethan-1-ol. |
| Q: What is the CAS number of 2-(2-{4-[(2,2,2-trifluoroethyl)amino]-1H-pyrazol-1-yl}ethoxy)ethan-1-ol? |
| A: CAS number of 2-(2-{4-[(2,2,2-trifluoroethyl)amino]-1H-pyrazol-1-yl}ethoxy)ethan-1-ol is 2171968-79-7. |
| Q: What is the molecular weight of 2-(2-{4-[(2,2,2-trifluoroethyl)amino]-1H-pyrazol-1-yl}ethoxy)ethan-1-ol? |
| A: Molecular weight of 2-(2-{4-[(2,2,2-trifluoroethyl)amino]-1H-pyrazol-1-yl}ethoxy)ethan-1-ol is 253.22. |