3-{[2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)cycloheptyl]formamido}propanoic acid
Modify Date: 2026-08-06 00:50:13
![3-{[2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)cycloheptyl]formamido}propanoic acid Structure](https://www.chemsrc.com/extcaspic/022/2171978-38-2.png)
3-{[2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)cycloheptyl]formamido}propanoic acid structure
|
Common Name | 3-{[2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)cycloheptyl]formamido}propanoic acid | ||
|---|---|---|---|---|
| CAS Number | 2171978-38-2 | Molecular Weight | 450.5 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C26H30N2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-{[2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)cycloheptyl]formamido}propanoic acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C26H30N2O5 |
|---|---|
| Molecular Weight | 450.5 |
| InChIKey | RRGLWKXOHCMVER-UHFFFAOYSA-N |
| SMILES | O=C(O)CCNC(=O)C1CCCCCC1NC(=O)OCC1c2ccccc2-c2ccccc21 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 3-{[2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)cycloheptyl]formamido}propanoic acid? |
| A: InChIKey of 3-{[2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)cycloheptyl]formamido}propanoic acid is RRGLWKXOHCMVER-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 2171978-38-2? |
| A: Chinese name of 2171978-38-2 is 2171978-38-2. |
| Q: What is the SMILES notation of 3-{[2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)cycloheptyl]formamido}propanoic acid? |
| A: SMILES notation of 3-{[2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)cycloheptyl]formamido}propanoic acid is O=C(O)CCNC(=O)C1CCCCCC1NC(=O)OCC1c2ccccc2-c2ccccc21. |
| Q: What is the English name of 3-{[2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)cycloheptyl]formamido}propanoic acid? |
| A: The English name of 3-{[2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)cycloheptyl]formamido}propanoic acid is 3-{[2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)cycloheptyl]formamido}propanoic acid. |
| Q: What is the molecular formula of 3-{[2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)cycloheptyl]formamido}propanoic acid? |
| A: Molecular formula of 3-{[2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)cycloheptyl]formamido}propanoic acid is C26H30N2O5. |
| Q: What is the CAS number of 3-{[2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)cycloheptyl]formamido}propanoic acid? |
| A: CAS number of 3-{[2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)cycloheptyl]formamido}propanoic acid is 2171978-38-2. |
| Q: What is the molecular weight of 3-{[2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)cycloheptyl]formamido}propanoic acid? |
| A: Molecular weight of 3-{[2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)cycloheptyl]formamido}propanoic acid is 450.5. |