2-Cyclopropyl-6-fluoro-1,3-benzothiazol-4-amine
Modify Date: 2026-08-13 18:26:37
2-Cyclopropyl-6-fluoro-1,3-benzothiazol-4-amine structure
|
Common Name | 2-Cyclopropyl-6-fluoro-1,3-benzothiazol-4-amine | ||
|---|---|---|---|---|
| CAS Number | 2171981-46-5 | Molecular Weight | 208.26 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H9FN2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-Cyclopropyl-6-fluoro-1,3-benzothiazol-4-amine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H9FN2S |
|---|---|
| Molecular Weight | 208.26 |
| InChIKey | GSWVCBRTOQFOAN-UHFFFAOYSA-N |
| SMILES | Nc1cc(F)cc2sc(C3CC3)nc12 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 2-Cyclopropyl-6-fluoro-1,3-benzothiazol-4-amine? |
| A: CAS number of 2-Cyclopropyl-6-fluoro-1,3-benzothiazol-4-amine is 2171981-46-5. |
| Q: What is the English name of 2-Cyclopropyl-6-fluoro-1,3-benzothiazol-4-amine? |
| A: The English name of 2-Cyclopropyl-6-fluoro-1,3-benzothiazol-4-amine is 2-Cyclopropyl-6-fluoro-1,3-benzothiazol-4-amine. |
| Q: What is the InChIKey of 2-Cyclopropyl-6-fluoro-1,3-benzothiazol-4-amine? |
| A: InChIKey of 2-Cyclopropyl-6-fluoro-1,3-benzothiazol-4-amine is GSWVCBRTOQFOAN-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 2171981-46-5? |
| A: Chinese name of 2171981-46-5 is 2171981-46-5. |
| Q: What is the SMILES notation of 2-Cyclopropyl-6-fluoro-1,3-benzothiazol-4-amine? |
| A: SMILES notation of 2-Cyclopropyl-6-fluoro-1,3-benzothiazol-4-amine is Nc1cc(F)cc2sc(C3CC3)nc12. |
| Q: What is the molecular weight of 2-Cyclopropyl-6-fluoro-1,3-benzothiazol-4-amine? |
| A: Molecular weight of 2-Cyclopropyl-6-fluoro-1,3-benzothiazol-4-amine is 208.26. |
| Q: What is the molecular formula of 2-Cyclopropyl-6-fluoro-1,3-benzothiazol-4-amine? |
| A: Molecular formula of 2-Cyclopropyl-6-fluoro-1,3-benzothiazol-4-amine is C10H9FN2S. |