4-{[2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)-1,3-thiazol-5-yl]formamido}-3-methylbutanoic acid structure
|
Common Name | 4-{[2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)-1,3-thiazol-5-yl]formamido}-3-methylbutanoic acid | ||
|---|---|---|---|---|
| CAS Number | 2172010-60-3 | Molecular Weight | 465.5 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C24H23N3O5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-{[2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)-1,3-thiazol-5-yl]formamido}-3-methylbutanoic acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C24H23N3O5S |
|---|---|
| Molecular Weight | 465.5 |
| InChIKey | NJSYVKXGMRMOFK-UHFFFAOYSA-N |
| SMILES | CC(CNC(=O)c1cnc(NC(=O)OCC2c3ccccc3-c3ccccc32)s1)CC(=O)O |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 2172010-60-3? |
| A: Chinese name of 2172010-60-3 is 2172010-60-3. |
| Q: What is the molecular weight of 4-{[2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)-1,3-thiazol-5-yl]formamido}-3-methylbutanoic acid? |
| A: Molecular weight of 4-{[2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)-1,3-thiazol-5-yl]formamido}-3-methylbutanoic acid is 465.5. |
| Q: What is the English name of 4-{[2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)-1,3-thiazol-5-yl]formamido}-3-methylbutanoic acid? |
| A: The English name of 4-{[2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)-1,3-thiazol-5-yl]formamido}-3-methylbutanoic acid is 4-{[2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)-1,3-thiazol-5-yl]formamido}-3-methylbutanoic acid. |
| Q: What is the CAS number of 4-{[2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)-1,3-thiazol-5-yl]formamido}-3-methylbutanoic acid? |
| A: CAS number of 4-{[2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)-1,3-thiazol-5-yl]formamido}-3-methylbutanoic acid is 2172010-60-3. |
| Q: What is the SMILES notation of 4-{[2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)-1,3-thiazol-5-yl]formamido}-3-methylbutanoic acid? |
| A: SMILES notation of 4-{[2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)-1,3-thiazol-5-yl]formamido}-3-methylbutanoic acid is CC(CNC(=O)c1cnc(NC(=O)OCC2c3ccccc3-c3ccccc32)s1)CC(=O)O. |
| Q: What is the InChIKey of 4-{[2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)-1,3-thiazol-5-yl]formamido}-3-methylbutanoic acid? |
| A: InChIKey of 4-{[2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)-1,3-thiazol-5-yl]formamido}-3-methylbutanoic acid is NJSYVKXGMRMOFK-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 4-{[2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)-1,3-thiazol-5-yl]formamido}-3-methylbutanoic acid? |
| A: Molecular formula of 4-{[2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)-1,3-thiazol-5-yl]formamido}-3-methylbutanoic acid is C24H23N3O5S. |