9-(Propan-2-yl)-2,12-dioxa-5-azadispiro[3.1.5^{6}.3^{4}]tetradecane
Modify Date: 2025-09-14 14:44:22
![9-(Propan-2-yl)-2,12-dioxa-5-azadispiro[3.1.5^{6}.3^{4}]tetradecane Structure](https://www.chemsrc.com/extcaspic/446/2172023-58-2.png)
9-(Propan-2-yl)-2,12-dioxa-5-azadispiro[3.1.5^{6}.3^{4}]tetradecane structure
|
Common Name | 9-(Propan-2-yl)-2,12-dioxa-5-azadispiro[3.1.5^{6}.3^{4}]tetradecane | ||
|---|---|---|---|---|
| CAS Number | 2172023-58-2 | Molecular Weight | 239.35 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H25NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 9-(Propan-2-yl)-2,12-dioxa-5-azadispiro[3.1.5^{6}.3^{4}]tetradecane |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H25NO2 |
|---|---|
| Molecular Weight | 239.35 |
| InChIKey | HSLHSHUJAYZARI-UHFFFAOYSA-N |
| SMILES | CC(C)C1CCC2(CC1)NC1(CCO2)COC1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 9-(Propan-2-yl)-2,12-dioxa-5-azadispiro[3.1.5^{6}.3^{4}]tetradecane? |
| A: Molecular formula of 9-(Propan-2-yl)-2,12-dioxa-5-azadispiro[3.1.5^{6}.3^{4}]tetradecane is C14H25NO2. |
| Q: What is the SMILES notation of 9-(Propan-2-yl)-2,12-dioxa-5-azadispiro[3.1.5^{6}.3^{4}]tetradecane? |
| A: SMILES notation of 9-(Propan-2-yl)-2,12-dioxa-5-azadispiro[3.1.5^{6}.3^{4}]tetradecane is CC(C)C1CCC2(CC1)NC1(CCO2)COC1. |
| Q: What is the InChIKey of 9-(Propan-2-yl)-2,12-dioxa-5-azadispiro[3.1.5^{6}.3^{4}]tetradecane? |
| A: InChIKey of 9-(Propan-2-yl)-2,12-dioxa-5-azadispiro[3.1.5^{6}.3^{4}]tetradecane is HSLHSHUJAYZARI-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 2172023-58-2? |
| A: Chinese name of 2172023-58-2 is 2172023-58-2. |
| Q: What is the CAS number of 9-(Propan-2-yl)-2,12-dioxa-5-azadispiro[3.1.5^{6}.3^{4}]tetradecane? |
| A: CAS number of 9-(Propan-2-yl)-2,12-dioxa-5-azadispiro[3.1.5^{6}.3^{4}]tetradecane is 2172023-58-2. |
| Q: What is the English name of 9-(Propan-2-yl)-2,12-dioxa-5-azadispiro[3.1.5^{6}.3^{4}]tetradecane? |
| A: The English name of 9-(Propan-2-yl)-2,12-dioxa-5-azadispiro[3.1.5^{6}.3^{4}]tetradecane is 9-(Propan-2-yl)-2,12-dioxa-5-azadispiro[3.1.5^{6}.3^{4}]tetradecane. |
| Q: What is the molecular weight of 9-(Propan-2-yl)-2,12-dioxa-5-azadispiro[3.1.5^{6}.3^{4}]tetradecane? |
| A: Molecular weight of 9-(Propan-2-yl)-2,12-dioxa-5-azadispiro[3.1.5^{6}.3^{4}]tetradecane is 239.35. |