1-(2-methylpropyl)-5-propyl-1H-1,2,3-triazole-4-carboxamide
Modify Date: 2026-08-18 21:33:15
1-(2-methylpropyl)-5-propyl-1H-1,2,3-triazole-4-carboxamide structure
|
Common Name | 1-(2-methylpropyl)-5-propyl-1H-1,2,3-triazole-4-carboxamide | ||
|---|---|---|---|---|
| CAS Number | 2172050-80-3 | Molecular Weight | 210.28 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H18N4O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-(2-methylpropyl)-5-propyl-1H-1,2,3-triazole-4-carboxamide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H18N4O |
|---|---|
| Molecular Weight | 210.28 |
| InChIKey | JZWUOORJXXCEIU-UHFFFAOYSA-N |
| SMILES | CCCc1c(C(N)=O)nnn1CC(C)C |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 1-(2-methylpropyl)-5-propyl-1H-1,2,3-triazole-4-carboxamide? |
| A: The English name of 1-(2-methylpropyl)-5-propyl-1H-1,2,3-triazole-4-carboxamide is 1-(2-methylpropyl)-5-propyl-1H-1,2,3-triazole-4-carboxamide. |
| Q: What is the InChIKey of 1-(2-methylpropyl)-5-propyl-1H-1,2,3-triazole-4-carboxamide? |
| A: InChIKey of 1-(2-methylpropyl)-5-propyl-1H-1,2,3-triazole-4-carboxamide is JZWUOORJXXCEIU-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 2172050-80-3? |
| A: Chinese name of 2172050-80-3 is 2172050-80-3. |
| Q: What is the SMILES notation of 1-(2-methylpropyl)-5-propyl-1H-1,2,3-triazole-4-carboxamide? |
| A: SMILES notation of 1-(2-methylpropyl)-5-propyl-1H-1,2,3-triazole-4-carboxamide is CCCc1c(C(N)=O)nnn1CC(C)C. |
| Q: What is the molecular formula of 1-(2-methylpropyl)-5-propyl-1H-1,2,3-triazole-4-carboxamide? |
| A: Molecular formula of 1-(2-methylpropyl)-5-propyl-1H-1,2,3-triazole-4-carboxamide is C10H18N4O. |
| Q: What is the CAS number of 1-(2-methylpropyl)-5-propyl-1H-1,2,3-triazole-4-carboxamide? |
| A: CAS number of 1-(2-methylpropyl)-5-propyl-1H-1,2,3-triazole-4-carboxamide is 2172050-80-3. |
| Q: What is the molecular weight of 1-(2-methylpropyl)-5-propyl-1H-1,2,3-triazole-4-carboxamide? |
| A: Molecular weight of 1-(2-methylpropyl)-5-propyl-1H-1,2,3-triazole-4-carboxamide is 210.28. |