N,3-dimethyl-5-phenyl-3H-[1,2,3]triazolo[4,5-d]pyrimidin-7-amine
Modify Date: 2025-08-25 09:20:30
![N,3-dimethyl-5-phenyl-3H-[1,2,3]triazolo[4,5-d]pyrimidin-7-amine Structure](https://www.chemsrc.com/extcaspic/115/2172053-99-3.png)
N,3-dimethyl-5-phenyl-3H-[1,2,3]triazolo[4,5-d]pyrimidin-7-amine structure
|
Common Name | N,3-dimethyl-5-phenyl-3H-[1,2,3]triazolo[4,5-d]pyrimidin-7-amine | ||
|---|---|---|---|---|
| CAS Number | 2172053-99-3 | Molecular Weight | 240.26 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H12N6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N,3-dimethyl-5-phenyl-3H-[1,2,3]triazolo[4,5-d]pyrimidin-7-amine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H12N6 |
|---|---|
| Molecular Weight | 240.26 |
| InChIKey | RUFCCRNHANDECI-UHFFFAOYSA-N |
| SMILES | CNc1nc(-c2ccccc2)nc2c1nnn2C |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of N,3-dimethyl-5-phenyl-3H-[1,2,3]triazolo[4,5-d]pyrimidin-7-amine? |
| A: Molecular formula of N,3-dimethyl-5-phenyl-3H-[1,2,3]triazolo[4,5-d]pyrimidin-7-amine is C12H12N6. |
| Q: What is the English name of N,3-dimethyl-5-phenyl-3H-[1,2,3]triazolo[4,5-d]pyrimidin-7-amine? |
| A: The English name of N,3-dimethyl-5-phenyl-3H-[1,2,3]triazolo[4,5-d]pyrimidin-7-amine is N,3-dimethyl-5-phenyl-3H-[1,2,3]triazolo[4,5-d]pyrimidin-7-amine. |
| Q: What is the Chinese name of 2172053-99-3? |
| A: Chinese name of 2172053-99-3 is 2172053-99-3. |
| Q: What is the CAS number of N,3-dimethyl-5-phenyl-3H-[1,2,3]triazolo[4,5-d]pyrimidin-7-amine? |
| A: CAS number of N,3-dimethyl-5-phenyl-3H-[1,2,3]triazolo[4,5-d]pyrimidin-7-amine is 2172053-99-3. |
| Q: What is the InChIKey of N,3-dimethyl-5-phenyl-3H-[1,2,3]triazolo[4,5-d]pyrimidin-7-amine? |
| A: InChIKey of N,3-dimethyl-5-phenyl-3H-[1,2,3]triazolo[4,5-d]pyrimidin-7-amine is RUFCCRNHANDECI-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of N,3-dimethyl-5-phenyl-3H-[1,2,3]triazolo[4,5-d]pyrimidin-7-amine? |
| A: SMILES notation of N,3-dimethyl-5-phenyl-3H-[1,2,3]triazolo[4,5-d]pyrimidin-7-amine is CNc1nc(-c2ccccc2)nc2c1nnn2C. |
| Q: What is the molecular weight of N,3-dimethyl-5-phenyl-3H-[1,2,3]triazolo[4,5-d]pyrimidin-7-amine? |
| A: Molecular weight of N,3-dimethyl-5-phenyl-3H-[1,2,3]triazolo[4,5-d]pyrimidin-7-amine is 240.26. |