2-(Trimethylsilyl)-1,3-thiazole-4-sulfonamide
Modify Date: 2025-11-02 19:03:58
2-(Trimethylsilyl)-1,3-thiazole-4-sulfonamide structure
|
Common Name | 2-(Trimethylsilyl)-1,3-thiazole-4-sulfonamide | ||
|---|---|---|---|---|
| CAS Number | 2172069-97-3 | Molecular Weight | 236.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C6H12N2O2S2Si | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-(Trimethylsilyl)-1,3-thiazole-4-sulfonamide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C6H12N2O2S2Si |
|---|---|
| Molecular Weight | 236.4 |
| InChIKey | MQIBXDCYYJXYLE-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)c1nc(S(N)(=O)=O)cs1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 2-(Trimethylsilyl)-1,3-thiazole-4-sulfonamide? |
| A: SMILES notation of 2-(Trimethylsilyl)-1,3-thiazole-4-sulfonamide is C[Si](C)(C)c1nc(S(N)(=O)=O)cs1. |
| Q: What is the Chinese name of 2172069-97-3? |
| A: Chinese name of 2172069-97-3 is 2172069-97-3. |
| Q: What is the CAS number of 2-(Trimethylsilyl)-1,3-thiazole-4-sulfonamide? |
| A: CAS number of 2-(Trimethylsilyl)-1,3-thiazole-4-sulfonamide is 2172069-97-3. |
| Q: What is the molecular formula of 2-(Trimethylsilyl)-1,3-thiazole-4-sulfonamide? |
| A: Molecular formula of 2-(Trimethylsilyl)-1,3-thiazole-4-sulfonamide is C6H12N2O2S2Si. |
| Q: What is the English name of 2-(Trimethylsilyl)-1,3-thiazole-4-sulfonamide? |
| A: The English name of 2-(Trimethylsilyl)-1,3-thiazole-4-sulfonamide is 2-(Trimethylsilyl)-1,3-thiazole-4-sulfonamide. |
| Q: What is the molecular weight of 2-(Trimethylsilyl)-1,3-thiazole-4-sulfonamide? |
| A: Molecular weight of 2-(Trimethylsilyl)-1,3-thiazole-4-sulfonamide is 236.4. |
| Q: What is the InChIKey of 2-(Trimethylsilyl)-1,3-thiazole-4-sulfonamide? |
| A: InChIKey of 2-(Trimethylsilyl)-1,3-thiazole-4-sulfonamide is MQIBXDCYYJXYLE-UHFFFAOYSA-N. |