3-{[3-chloro-5-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)phenyl]formamido}-3-methylbutanoic acid structure
|
Common Name | 3-{[3-chloro-5-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)phenyl]formamido}-3-methylbutanoic acid | ||
|---|---|---|---|---|
| CAS Number | 2172132-45-3 | Molecular Weight | 492.9 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C27H25ClN2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-{[3-chloro-5-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)phenyl]formamido}-3-methylbutanoic acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C27H25ClN2O5 |
|---|---|
| Molecular Weight | 492.9 |
| InChIKey | RTEPFFQIRWOOLC-UHFFFAOYSA-N |
| SMILES | CC(C)(CC(=O)O)NC(=O)c1cc(Cl)cc(NC(=O)OCC2c3ccccc3-c3ccccc32)c1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 2172132-45-3? |
| A: Chinese name of 2172132-45-3 is 2172132-45-3. |
| Q: What is the InChIKey of 3-{[3-chloro-5-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)phenyl]formamido}-3-methylbutanoic acid? |
| A: InChIKey of 3-{[3-chloro-5-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)phenyl]formamido}-3-methylbutanoic acid is RTEPFFQIRWOOLC-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of 3-{[3-chloro-5-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)phenyl]formamido}-3-methylbutanoic acid? |
| A: SMILES notation of 3-{[3-chloro-5-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)phenyl]formamido}-3-methylbutanoic acid is CC(C)(CC(=O)O)NC(=O)c1cc(Cl)cc(NC(=O)OCC2c3ccccc3-c3ccccc32)c1. |
| Q: What is the English name of 3-{[3-chloro-5-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)phenyl]formamido}-3-methylbutanoic acid? |
| A: The English name of 3-{[3-chloro-5-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)phenyl]formamido}-3-methylbutanoic acid is 3-{[3-chloro-5-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)phenyl]formamido}-3-methylbutanoic acid. |
| Q: What is the CAS number of 3-{[3-chloro-5-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)phenyl]formamido}-3-methylbutanoic acid? |
| A: CAS number of 3-{[3-chloro-5-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)phenyl]formamido}-3-methylbutanoic acid is 2172132-45-3. |
| Q: What is the molecular weight of 3-{[3-chloro-5-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)phenyl]formamido}-3-methylbutanoic acid? |
| A: Molecular weight of 3-{[3-chloro-5-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)phenyl]formamido}-3-methylbutanoic acid is 492.9. |
| Q: What is the molecular formula of 3-{[3-chloro-5-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)phenyl]formamido}-3-methylbutanoic acid? |
| A: Molecular formula of 3-{[3-chloro-5-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)phenyl]formamido}-3-methylbutanoic acid is C27H25ClN2O5. |