3-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)-3-(thian-4-yl)butanoic acid
Modify Date: 2025-08-28 21:35:12
![3-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)-3-(thian-4-yl)butanoic acid Structure](https://www.chemsrc.com/extcaspic/179/2172151-15-2.png)
3-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)-3-(thian-4-yl)butanoic acid structure
|
Common Name | 3-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)-3-(thian-4-yl)butanoic acid | ||
|---|---|---|---|---|
| CAS Number | 2172151-15-2 | Molecular Weight | 425.5 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C24H27NO4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)-3-(thian-4-yl)butanoic acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C24H27NO4S |
|---|---|
| Molecular Weight | 425.5 |
| InChIKey | VCPHKZMMOKPCHB-UHFFFAOYSA-N |
| SMILES | CC(CC(=O)O)(NC(=O)OCC1c2ccccc2-c2ccccc21)C1CCSCC1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 3-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)-3-(thian-4-yl)butanoic acid? |
| A: CAS number of 3-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)-3-(thian-4-yl)butanoic acid is 2172151-15-2. |
| Q: What is the InChIKey of 3-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)-3-(thian-4-yl)butanoic acid? |
| A: InChIKey of 3-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)-3-(thian-4-yl)butanoic acid is VCPHKZMMOKPCHB-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 3-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)-3-(thian-4-yl)butanoic acid? |
| A: Molecular weight of 3-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)-3-(thian-4-yl)butanoic acid is 425.5. |
| Q: What is the English name of 3-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)-3-(thian-4-yl)butanoic acid? |
| A: The English name of 3-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)-3-(thian-4-yl)butanoic acid is 3-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)-3-(thian-4-yl)butanoic acid. |
| Q: What is the Chinese name of 2172151-15-2? |
| A: Chinese name of 2172151-15-2 is 2172151-15-2. |
| Q: What is the molecular formula of 3-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)-3-(thian-4-yl)butanoic acid? |
| A: Molecular formula of 3-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)-3-(thian-4-yl)butanoic acid is C24H27NO4S. |
| Q: What is the SMILES notation of 3-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)-3-(thian-4-yl)butanoic acid? |
| A: SMILES notation of 3-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)-3-(thian-4-yl)butanoic acid is CC(CC(=O)O)(NC(=O)OCC1c2ccccc2-c2ccccc21)C1CCSCC1. |