5-tert-butyl-1-methyl-3-{[(propan-2-yl)amino]methyl}-1H-indole-2-carbonitrile
Modify Date: 2025-11-06 23:01:11
![5-tert-butyl-1-methyl-3-{[(propan-2-yl)amino]methyl}-1H-indole-2-carbonitrile Structure](https://www.chemsrc.com/extcaspic/129/2172159-53-2.png)
5-tert-butyl-1-methyl-3-{[(propan-2-yl)amino]methyl}-1H-indole-2-carbonitrile structure
|
Common Name | 5-tert-butyl-1-methyl-3-{[(propan-2-yl)amino]methyl}-1H-indole-2-carbonitrile | ||
|---|---|---|---|---|
| CAS Number | 2172159-53-2 | Molecular Weight | 283.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H25N3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 5-tert-butyl-1-methyl-3-{[(propan-2-yl)amino]methyl}-1H-indole-2-carbonitrile |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C18H25N3 |
|---|---|
| Molecular Weight | 283.4 |
| InChIKey | KGKDDIGAODRZLX-UHFFFAOYSA-N |
| SMILES | CC(C)NCc1c(C#N)n(C)c2ccc(C(C)(C)C)cc12 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 2172159-53-2? |
| A: Chinese name of 2172159-53-2 is 2172159-53-2. |
| Q: What is the molecular formula of 5-tert-butyl-1-methyl-3-{[(propan-2-yl)amino]methyl}-1H-indole-2-carbonitrile? |
| A: Molecular formula of 5-tert-butyl-1-methyl-3-{[(propan-2-yl)amino]methyl}-1H-indole-2-carbonitrile is C18H25N3. |
| Q: What is the InChIKey of 5-tert-butyl-1-methyl-3-{[(propan-2-yl)amino]methyl}-1H-indole-2-carbonitrile? |
| A: InChIKey of 5-tert-butyl-1-methyl-3-{[(propan-2-yl)amino]methyl}-1H-indole-2-carbonitrile is KGKDDIGAODRZLX-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 5-tert-butyl-1-methyl-3-{[(propan-2-yl)amino]methyl}-1H-indole-2-carbonitrile? |
| A: Molecular weight of 5-tert-butyl-1-methyl-3-{[(propan-2-yl)amino]methyl}-1H-indole-2-carbonitrile is 283.4. |
| Q: What is the English name of 5-tert-butyl-1-methyl-3-{[(propan-2-yl)amino]methyl}-1H-indole-2-carbonitrile? |
| A: The English name of 5-tert-butyl-1-methyl-3-{[(propan-2-yl)amino]methyl}-1H-indole-2-carbonitrile is 5-tert-butyl-1-methyl-3-{[(propan-2-yl)amino]methyl}-1H-indole-2-carbonitrile. |
| Q: What is the CAS number of 5-tert-butyl-1-methyl-3-{[(propan-2-yl)amino]methyl}-1H-indole-2-carbonitrile? |
| A: CAS number of 5-tert-butyl-1-methyl-3-{[(propan-2-yl)amino]methyl}-1H-indole-2-carbonitrile is 2172159-53-2. |
| Q: What is the SMILES notation of 5-tert-butyl-1-methyl-3-{[(propan-2-yl)amino]methyl}-1H-indole-2-carbonitrile? |
| A: SMILES notation of 5-tert-butyl-1-methyl-3-{[(propan-2-yl)amino]methyl}-1H-indole-2-carbonitrile is CC(C)NCc1c(C#N)n(C)c2ccc(C(C)(C)C)cc12. |