5'-Tert-butyl-4-azaspiro[bicyclo[2.2.2]octane-2,2'-[1,3]oxazinane]
Modify Date: 2025-09-17 14:08:35
![5'-Tert-butyl-4-azaspiro[bicyclo[2.2.2]octane-2,2'-[1,3]oxazinane] Structure](https://www.chemsrc.com/extcaspic/203/2172201-69-1.png)
5'-Tert-butyl-4-azaspiro[bicyclo[2.2.2]octane-2,2'-[1,3]oxazinane] structure
|
Common Name | 5'-Tert-butyl-4-azaspiro[bicyclo[2.2.2]octane-2,2'-[1,3]oxazinane] | ||
|---|---|---|---|---|
| CAS Number | 2172201-69-1 | Molecular Weight | 238.37 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H26N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 5'-Tert-butyl-4-azaspiro[bicyclo[2.2.2]octane-2,2'-[1,3]oxazinane] |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H26N2O |
|---|---|
| Molecular Weight | 238.37 |
| InChIKey | UHWUQFGBTVJIKN-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1CNC2(CN3CCC2CC3)OC1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 2172201-69-1? |
| A: Chinese name of 2172201-69-1 is 2172201-69-1. |
| Q: What is the InChIKey of 5'-Tert-butyl-4-azaspiro[bicyclo[2.2.2]octane-2,2'-[1,3]oxazinane]? |
| A: InChIKey of 5'-Tert-butyl-4-azaspiro[bicyclo[2.2.2]octane-2,2'-[1,3]oxazinane] is UHWUQFGBTVJIKN-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 5'-Tert-butyl-4-azaspiro[bicyclo[2.2.2]octane-2,2'-[1,3]oxazinane]? |
| A: Molecular weight of 5'-Tert-butyl-4-azaspiro[bicyclo[2.2.2]octane-2,2'-[1,3]oxazinane] is 238.37. |
| Q: What is the molecular formula of 5'-Tert-butyl-4-azaspiro[bicyclo[2.2.2]octane-2,2'-[1,3]oxazinane]? |
| A: Molecular formula of 5'-Tert-butyl-4-azaspiro[bicyclo[2.2.2]octane-2,2'-[1,3]oxazinane] is C14H26N2O. |
| Q: What is the English name of 5'-Tert-butyl-4-azaspiro[bicyclo[2.2.2]octane-2,2'-[1,3]oxazinane]? |
| A: The English name of 5'-Tert-butyl-4-azaspiro[bicyclo[2.2.2]octane-2,2'-[1,3]oxazinane] is 5'-Tert-butyl-4-azaspiro[bicyclo[2.2.2]octane-2,2'-[1,3]oxazinane]. |
| Q: What is the SMILES notation of 5'-Tert-butyl-4-azaspiro[bicyclo[2.2.2]octane-2,2'-[1,3]oxazinane]? |
| A: SMILES notation of 5'-Tert-butyl-4-azaspiro[bicyclo[2.2.2]octane-2,2'-[1,3]oxazinane] is CC(C)(C)C1CNC2(CN3CCC2CC3)OC1. |
| Q: What is the CAS number of 5'-Tert-butyl-4-azaspiro[bicyclo[2.2.2]octane-2,2'-[1,3]oxazinane]? |
| A: CAS number of 5'-Tert-butyl-4-azaspiro[bicyclo[2.2.2]octane-2,2'-[1,3]oxazinane] is 2172201-69-1. |